|
|
| | 1,6-Hexanediol diglycidyl ether Basic information |
| Product Name: | 1,6-Hexanediol diglycidyl ether | | Synonyms: | 1,6-HEXANEDIOL DIGLYCIDYL ETHER;2,2’-[1,6-hexanediylbis(oxymethylene)]bis-oxiran;Oxirane, 2,2-1,6-hexanediylbis(oxymethylene)bis-;1,6-Bis(2,3-epoxypropoxy)hexan;(generic)phosphoramide;2,2'-(1,6-Hexanediylbis(oxymethylene))oxirane;1,6-Bis(glycidyloxy)hexane;6-Hexanediol diglycidyl ether | | CAS: | 16096-31-4 | | MF: | C12H22O4 | | MW: | 230.3 | | EINECS: | 240-260-4 | | Product Categories: | | | Mol File: | 16096-31-4.mol |  |
| | 1,6-Hexanediol diglycidyl ether Chemical Properties |
| Boiling point | 132 °C(Press: 0.2 Torr) | | density | 1.076±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | Appearance | Colorless to off-white Liquid | | InChI | InChI=1S/C12H22O4/c1(3-5-13-7-11-9-15-11)2-4-6-14-8-12-10-16-12/h11-12H,1-10H2 | | InChIKey | WTYYGFLRBWMFRY-UHFFFAOYSA-N | | SMILES | C(OCC1CO1)CCCCCOCC1CO1 | | CAS DataBase Reference | 16096-31-4 | | EPA Substance Registry System | Oxirane, 2,2'-[1,6-hexanediylbis(oxymethylene)]bis- (16096-31-4) |
| | 1,6-Hexanediol diglycidyl ether Usage And Synthesis |
| Uses | Its primary use is as a reactive diluent in epoxy resin
systems to reduce viscosity and to allow higher filler loading. | | Production Methods | The compound results from condensation of hexanediol with
epichlorohydrin followed by dehydrochlorination with caustic. | | Contact allergens | This chemical is a reactive diluent in epoxy resins. |
| | 1,6-Hexanediol diglycidyl ether Preparation Products And Raw materials |
|