|
|
| | (1S)-(+)-Camphor-10-sulphonic acid Basic information | | Synthesis |
| | (1S)-(+)-Camphor-10-sulphonic acid Chemical Properties |
| Melting point | 196-200 °C (dec.)(lit.) | | alpha | 22 º (589nm, c=20, H2O 25 ºC) | | Boiling point | 344.46°C (rough estimate) | | density | 1.2981 (rough estimate) | | refractive index | 21.5 ° (C=5, H2O) | | storage temp. | Store below +30°C. | | solubility | Exhibit moderate solubility in HCCl. | | pka | 1.17±0.50(Predicted) | | form | Crystalline Powder | | color | White to off-white | | PH | 0.3 (200g/l, H2O) | | biological source | human | | Optical Rotation | [α]20/D +21.5±1°, c = 10% in H2O | | Water Solubility | SOLUBLE | | Sensitive | Hygroscopic | | Merck | 14,1734 | | BRN | 2809675 | | Stability: | Stable. Protect from moisture. Incompatible with strong oxidizing agents, strong bases. | | InChIKey | MIOPJNTWMNEORI-GMSGAONNSA-N | | CAS DataBase Reference | 3144-16-9(CAS DataBase Reference) | | EPA Substance Registry System | Bicyclo[2.2.1]heptane-1-methanesulfonic acid, 7,7-dimethyl-2-oxo-, (1S,4R)- (3144-16-9) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45-25-27 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | RTECS | ED1550000 | | F | 3-10 | | TSCA | Yes | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29147090 |
| | (1S)-(+)-Camphor-10-sulphonic acid Usage And Synthesis |
| Synthesis | (1S)-(+)-Camphor-10-sulphonic acid can be obtained from natural camphor by brominated sulfonation . | | Chemical Properties | white to light beige powder | | Uses | Used as a resolving agent, and as a catalyst for coupling dipeptides. | | Uses | (1S)-(+)-Camphor-10-sulfonic acid is used as stabilizer. (+)-(1S)-camphor-10-sulfonic acid being a very effective resolving agent. . Chiral polyaniline(PANI) nanofibers were synthesized via facilely potentiostatic electropolymerization method without template in the presence of(1S)-(+)camphor-10-sulfonic acid(D-CSA) or(1R)-(-)camphor-10-sulfonic acid(L-CSA) as the dopant. Synthesis of QUATs derived from (1S)-(+)camphor-10-sulfonic acid. | | Definition | ChEBI: (S)-camphorsulfonic acid is the S enantiomer of camphorsulfonic acid. It is a conjugate acid of a (S)-camphorsulfonate. It is an enantiomer of a (R)-camphorsulfonic acid. | | Purification Methods | Crystallise the acid from ethyl acetate and dry it under vacuum (deliquescent). [Loudon J Chem Soc 823 1933, Komppa J Prakt Chem 162 19 1943, Beilstein 11 IV 642.] See above for RS-isomer. |
| | (1S)-(+)-Camphor-10-sulphonic acid Preparation Products And Raw materials |
|