- Fmoc-L-Ala-OH
-
- $0.00/ kg
-
2026-01-28
- CAS:35661-39-3
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
- FMOC-Ala-OH
-
- $0.00 / 25Kg/Drum
-
2026-01-28
- CAS:35661-39-3
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 1000kg
- FMOC-Ala-OH
-
- $10.00 / 1KG
-
2026-01-05
- CAS:35661-39-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
|
| | FMOC-Ala-OH Basic information |
| | FMOC-Ala-OH Chemical Properties |
| Melting point | 147-153 °C (lit.) | | alpha | -19 º (c=1,DMF) | | Boiling point | 451.38°C (rough estimate) | | density | 1.2626 (rough estimate) | | refractive index | -18.5 ° (C=1, DMF) | | storage temp. | Store below +30°C. | | solubility | DMSO (Slightly), DMF (Sparingly), Methanol (Slightly) | | pka | 3.91±0.10(Predicted) | | form | Solid | | color | White | | Optical Rotation | [α]20/D 18°, c = 1 in DMF | | Water Solubility | Soluble in water. | | BRN | 2225975 | | Major Application | peptide synthesis | | InChI | 1S/C18H17NO4/c1-11(17(20)21)19-18(22)23-10-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-9,11,16H,10H2,1H3,(H,19,22)(H,20,21)/t11-/m0/s1 | | InChIKey | QWXZOFZKSQXPDC-NSHDSACASA-N | | SMILES | C[C@H](NC(=O)OCC1c2ccccc2-c3ccccc13)C(O)=O | | CAS DataBase Reference | 35661-39-3(CAS DataBase Reference) | | CAS Number Unlabeled | 35661-39-3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25-36/37/39-27-26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 11 - Combustible Solids |
| | FMOC-Ala-OH Usage And Synthesis |
| Description | FMOC-Ala-OH is a versatile reagent used in Fmoc solid-phase peptide synthesis.
| | Chemical Properties | white to light yellow crystal powde | | Uses | FMOC-Ala-OH is potentially useful for proteomics studies and solid phase peptide synthesis techniques. Alanine is one of the simplest amino acids - a methyl group as the side chain. This small side chain confers a high degree of flexibility when incorporated into a polypeptide chain. The Fmoc group is typically removed with a base such as pyridine - an orthogonal de-protection strategy to the acid labilie Boc group. | | Preparation | A solution of the Fmoc-OX derivatives (20 mmol) in 100 mL acetone was added dropwise to a stirred solution of Alanine (20 mmol) and NaHCO3 (50 mmol) in 100 mL water. After stirring overnight the reaction mixture was concentrated under reduced pressure and then extracted with CH2Cl2 (50 mL) to remove the unreacted Fmoc-OX derivatives. The reaction mixture was cooled and acidified with 10% HCl to congo red litmus paper to give a white solid, which was filtered and washed with water several times, dried to give a white solid (FMOC-Ala-OH).Yield=89.5%.
 | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-Ala-OH Preparation Products And Raw materials |
|