Sodium difluoromethanesulfinate manufacturers
|
| | Sodium difluoromethanesulfinate Basic information |
| Product Name: | Sodium difluoromethanesulfinate | | Synonyms: | Sodium difluoromethanesulfinate, 98%;Sodium difluoromethylsulfinate;Difluoromethanesulfinic acid sodium;Difluoromethanesulfinic acid sodium, tech grade;difluoromethanesulfinate;Sodium difluoromethanesulfinate | | CAS: | 275818-95-6 | | MF: | CH3F2NaO2S | | MW: | 140.08 | | EINECS: | | | Product Categories: | | | Mol File: | 275818-95-6.mol |  |
| | Sodium difluoromethanesulfinate Chemical Properties |
| storage temp. | -20°C, stored under nitrogen | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/CH2F2O2S.Na.H/c2-1(3)6(4)5;;/h1H,(H,4,5);; | | InChIKey | BFIWVQBTDOAIPB-UHFFFAOYSA-N | | SMILES | C(F)(F)S(O)=O.[NaH] |
| | Sodium difluoromethanesulfinate Usage And Synthesis |
| Uses | Sodium difluoromethanesulfinate as efficient radical fluoroalkylating reagents,it is able to react with conjugated N-arylsulfonated amides to yield the desired fluoroalkylamides.
| | Reactions | 
Ref. 1) He, Z.; Tan, P.; Ni, C.; Hu, J. Org. Lett. 2015, 17, 1838 –1841. (The invention of HCF2SO2Na and H2CFSO2Na as radical fluoroalkylation reagents)
2) Dai, P.; Yu, X.; Teng, P.; Zhang, W.-H.; Deng, C. Org. Lett. 2018, 20, 69016905.
3) Zhang, W. et al. Nat. Commun. 2020, 11, art. no. 638. (HCF2SO2Na was referred to as Hu’s reagent) |
| | Sodium difluoromethanesulfinate Preparation Products And Raw materials |
|