|
|
| | 4,7-Dimethyl-1,10-phenanthroline Basic information |
| Product Name: | 4,7-Dimethyl-1,10-phenanthroline | | Synonyms: | 4,7-DIMETHYL-1,10-PHENANTHROLINE;TIMTEC-BB SBB008716;1,10-Phenanthroline, 4,7-dimethyl-;4,7-dimethyl-10-phenanthroline;4,7-Dimethyl-o-phenanthroline;4,7-DIMETHYL-1,10-PHENANTHROLINE ANHYDROUS;1,8-Dimethyl-4,5-diazaphenanthrene;4,7-diMethy-1,10-phenathroline(Monohydrate) | | CAS: | 3248-05-3 | | MF: | C14H12N2 | | MW: | 208.26 | | EINECS: | 221-827-5 | | Product Categories: | | | Mol File: | 3248-05-3.mol |  |
| | 4,7-Dimethyl-1,10-phenanthroline Chemical Properties |
| Melting point | 193-195 °C(lit.) | | Boiling point | 338.63°C (rough estimate) | | density | 1.1202 (rough estimate) | | refractive index | 1.6152 (estimate) | | Fp | 177.00°C | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 6.01±0.10(Predicted) | | color | White to Gray to Brown | | Water Solubility | Soluble in benzene and alcohol. Slightly soluble in water. | | InChI | InChI=1S/C14H12N2/c1-9-5-7-15-13-11(9)3-4-12-10(2)6-8-16-14(12)13/h3-8H,1-2H3 | | InChIKey | JIVLDFFWTQYGSR-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=C3C=2N=CC=C3C)C(C)=CC=1 | | CAS DataBase Reference | 3248-05-3(CAS DataBase Reference) | | NIST Chemistry Reference | 4,7-Dimethyl-1,10-phenanthroline(3248-05-3) | | EPA Substance Registry System | 1,10-Phenanthroline, 4,7-dimethyl- (3248-05-3) |
| | 4,7-Dimethyl-1,10-phenanthroline Usage And Synthesis |
| Chemical Properties | Pale brown powder | | Uses | 4,7-Dimethyl-1,10-phenanthroline acts as an intermediate in synthetic chemistry and dyestuff field. It is also used as an organic bidentate ligand and form complexes with metal for detection. Further, it plays an important role in colorimetric sensors, coordination polymer, ionochromism and luminescence. |
| | 4,7-Dimethyl-1,10-phenanthroline Preparation Products And Raw materials |
|