1H,1H-PERFLUORO-1-NONANOL manufacturers
|
| | 1H,1H-PERFLUORO-1-NONANOL Basic information |
| Product Name: | 1H,1H-PERFLUORO-1-NONANOL | | Synonyms: | 8:1 FTOH;1H,1H-HEPTADECAFLUORONONANOL;1H,1H-PERFLUORO-1-NONANOL;1H,1H-PERFLUORONONAN-1-OL;1H,1H-PERFLUORONONANOL;2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-HEPTADECAFLUORO-1-NONANOL;2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-HEPTADECAFLUORO-1-NONANOL 96%;2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluoro-1-nonanol | | CAS: | 423-56-3 | | MF: | C9H3F17O | | MW: | 450.09 | | EINECS: | 670-435-4 | | Product Categories: | Fluorous Synthesis;Rf-Tagged Building Blocks and Precursors;Specialty Synthesis | | Mol File: | 423-56-3.mol |  |
| | 1H,1H-PERFLUORO-1-NONANOL Chemical Properties |
| Melting point | 66-69 °C (lit.) | | Boiling point | 176 °C/740 mmHg (lit.) | | density | 1.6660 (estimate) | | Fp | 176°C | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 12.88±0.10(Predicted) | | color | White to Off-White | | Water Solubility | Insoluble in water. | | BRN | 1809099 | | InChI | 1S/C9H3F17O/c10-2(11,1-27)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)26/h27H,1H2 | | InChIKey | BSXJTDJJVULBTQ-UHFFFAOYSA-N | | SMILES | OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | | CAS DataBase Reference | 423-56-3(CAS DataBase Reference) | | EPA Substance Registry System | 8:1 Fluorotelomer alcohol (423-56-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29055900 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Lact. Repr. 1B STOT RE 1 |
| | 1H,1H-PERFLUORO-1-NONANOL Usage And Synthesis |
| Chemical Properties | WHITE TRANSPARENT CRYSTALS | | Uses | 1H,1H-Perfluoro-1-nonanol is used to produce other chemicals. For example, it is used to produce Trifluoro-methanesulfonic acid 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-nonyl ester. This reaction needs reagent Pyridine and solvent CHCl3 |
| | 1H,1H-PERFLUORO-1-NONANOL Preparation Products And Raw materials |
| Preparation Products | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl acrylate |
|