|
|
| | 2-(TRIBUTYLSTANNYL)PYRAZINE Basic information |
| | 2-(TRIBUTYLSTANNYL)PYRAZINE Chemical Properties |
| Boiling point | 130 °C/1 mmHg | | density | 1.1706 g/mL at 25 °C | | refractive index | n20/D 1.5158 | | Fp | 113 °C | | storage temp. | -20°C | | pka | 0.94±0.10(Predicted) | | form | liquid | | color | Clear, light yellow | | InChI | 1S/C4H3N2.3C4H9.Sn/c1-2-6-4-3-5-1;3*1-3-4-2;/h1-3H;3*1,3-4H2,2H3; | | InChIKey | OVBXTKIWZAHFAC-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)c1cnccn1 | | CAS DataBase Reference | 205371-27-3 |
| Hazard Codes | T,N | | Risk Statements | 20/21/22-36/37/38-50/53-48/23/25-36/38-25-21 | | Safety Statements | 26-36/37/39-61-60-45-35 | | RIDADR | UN 2788 6.1/PG 2 | | WGK Germany | 3 | | Hazard Note | Toxic | | HazardClass | KEEP COLD | | HazardClass | 6.1 | | HS Code | 29339900 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |
| | 2-(TRIBUTYLSTANNYL)PYRAZINE Usage And Synthesis |
| Uses | Microwave-assisted synthesis of substituted pyranones by palladium-catalyzed cross-coupling of arylstannanes with pyranyl triflates. |
| | 2-(TRIBUTYLSTANNYL)PYRAZINE Preparation Products And Raw materials |
|