2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid manufacturers
|
| | 2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid Basic information |
| Product Name: | 2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid | | Synonyms: | BUTTPARK 29\02-68;2,2-DIFLUORO-1,3-BENZODIOXOLE-4-CARBOXYLIC ACID;RARECHEM AL BE 0476;2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid, 97+%;2,3-(Difluoromethylenedioxy)benzoic acid, 4-Carboxy-2,2-difluoro-1,3-benzodioxole;2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid 97%;1,3-Benzodioxole-4-carboxylic acid, 2,2-difluoro-;2,2-Difluorobenzo[d][1,3]dioxole-4-carboxylic acid | | CAS: | 126120-85-2 | | MF: | C8H4F2O4 | | MW: | 202.11 | | EINECS: | | | Product Categories: | | | Mol File: | 126120-85-2.mol |  |
| | 2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid Chemical Properties |
| Melting point | 202-205°C | | Boiling point | 260.8±40.0 °C(Predicted) | | density | 1.66±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.49±0.40(Predicted) | | color | White to Off-White | | BRN | 7292629 | | InChI | 1S/C8H4F2O4/c9-8(10)13-5-3-1-2-4(7(11)12)6(5)14-8/h1-3H,(H,11,12) | | InChIKey | ZGAQVJDFFVTWJK-UHFFFAOYSA-N | | SMILES | OC(=O)c1cccc2OC(F)(F)Oc12 | | CAS DataBase Reference | 126120-85-2(CAS DataBase Reference) |
| Hazard Codes | Xi,N,Xn | | Risk Statements | 36/37/38-50-41-22 | | Safety Statements | 26-36-61-39 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Eye Dam. 1 |
| Provider | Language |
|
ALFA
| English |
| | 2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid Usage And Synthesis |
| | 2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid Preparation Products And Raw materials |
|