|
|
| | 2,2'-(1,3-Phenylene)bis[5-(4-tert-butylphenyl)-1,3,4-oxadiazole] Basic information | | Applications |
| Product Name: | 2,2'-(1,3-Phenylene)bis[5-(4-tert-butylphenyl)-1,3,4-oxadiazole] | | Synonyms: | 1,3-BIS[5-(4-(1,1-DIMETHYLETHYL)PHENYL)-1,3,4-OXADIAZOL-2-YL]BENZENE;2,2'-(1,3-Phenylene)bis5-4-(1,1-dimethylethyl)phenyl-1,3,4-Oxadiazole;1,3-Bis[2-(4-tert-butylphenyl)-1,3,4-oxadiazole-5-yl]benzene;1,3-Bis[5-(4-tert-butylphenyl)-1,3,4-oxadiazole-2-yl]benzene;2,2'-(1,3-Phenylene)bis[5-(p-tert-butylphenyl)-1,3,4-oxadiazole];2,2'-(3,1-Phenylene)bis[5-[4-tert-butylphenyl]-1,3,4-oxadiazole];2,2'-m-Phenylenebis[5-(4-tert-butylphenyl)-1,3,4-oxadiazole];1,3-Bis[2-(4-tert-butylphenyl)-1,3,4-oxadiazo-5-yl]benzene | | CAS: | 138372-67-5 | | MF: | C30H30N4O2 | | MW: | 478.58 | | EINECS: | | | Product Categories: | olde Materials;electronic;White powder;OLED | | Mol File: | 138372-67-5.mol | ![2,2'-(1,3-Phenylene)bis[5-(4-tert-butylphenyl)-1,3,4-oxadiazole] Structure](CAS/GIF/138372-67-5.gif) |
| | 2,2'-(1,3-Phenylene)bis[5-(4-tert-butylphenyl)-1,3,4-oxadiazole] Chemical Properties |
| Melting point | 241.42-243.29°C | | Boiling point | 625.7±65.0 °C(Predicted) | | density | 1.132 | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | -5.37±0.39(Predicted) | | λmax | 292nm(CH2Cl2)(lit.) | | InChI | InChI=1S/C30H30N4O2/c1-29(2,3)23-14-10-19(11-15-23)25-31-33-27(35-25)21-8-7-9-22(18-21)28-34-32-26(36-28)20-12-16-24(17-13-20)30(4,5)6/h7-18H,1-6H3 | | InChIKey | FQJQNLKWTRGIEB-UHFFFAOYSA-N | | SMILES | C1(C2=NN=C(C3=CC=C(C(C)(C)C)C=C3)O2)=CC=CC(C2=NN=C(C3=CC=C(C(C)(C)C)C=C3)O2)=C1 | | CAS DataBase Reference | 138372-67-5 | | color | White powder/crystals | | Absorption | λmax 292 (THF) |
| | 2,2'-(1,3-Phenylene)bis[5-(4-tert-butylphenyl)-1,3,4-oxadiazole] Usage And Synthesis |
| Applications | 1,3-bis[2-(4-tert-butylphenyl)-1,3,4-oxadiazo-5-yl]benzene (OXD-7) is a well known electron-transporting material due to the electron-accepting property of the oxadiazole units.
Together with poly(9-vinylcarbazole) (PVK, electron donating), OXD-7 (electron withdrawing) is the most widely used hybrid-type host due to its good solubility and film morphology by the bulky tert-butyl units.
OXD-7 has also been used as an ultraviolet emitter, with MoO3 as hole injection and buffer material showing relatively high external quantum efficiency.
| | Description | 1,3-bis[2-(4-tert-butylphenyl)-1,3,4-oxadiazo-5-yl]benzene (OXD-7) is a well known electron-transporting material due totheelectron-acceptingproperty ofthe oxadiazole units. Together with poly(9-vinylcarbazole) (PVK, electron donating), OXD-7 (electron withdrawing) is the most widely used hybrid-type host due to its good solubility and film morphology by the bulky tert-butyl units. |
| | 2,2'-(1,3-Phenylene)bis[5-(4-tert-butylphenyl)-1,3,4-oxadiazole] Preparation Products And Raw materials |
|