|
|
| | Chloramphenicol sodium succinate Basic information |
| Product Name: | Chloramphenicol sodium succinate | | Synonyms: | CHLORAMPHENICOL ALPHA-SUCCINATE SODIUM SALT;CHLORAMPHENICOL SODIUM SUCCINATE;CHLORAMPHENICOL SUCCINATE SODIUM;CHLORAMPHENICOL SUCCINATE SODIUM SALT;alpha-esterwithsodiumsuccinate;chloramphenicolmonosuccinatesodiumsalt;chloramphenicolsodiummonosuccinate;chloramphenicolsuccinatesodium*minimum80%(hpl | | CAS: | 982-57-0 | | MF: | C15H15Cl2N2O8.Na | | MW: | 445.19 | | EINECS: | 213-568-1 | | Product Categories: | GLOBENICOL | | Mol File: | 982-57-0.mol |  |
| | Chloramphenicol sodium succinate Chemical Properties |
| Melting point | >42oC (dec.) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | H2O: soluble50mg/mL | | form | solid | | color | White to Off-White | | Major Application | pharmaceutical (small molecule) | | InChIKey | RPLOPBHEZLFENN-HTMVYDOJSA-M | | SMILES | [Na].O[C@@H]([C@@H](COC(=O)CCC(O)=O)NC(=O)C(Cl)Cl)c1ccc(cc1)N(=O)=O | | CAS DataBase Reference | 982-57-0(CAS DataBase Reference) | | EPA Substance Registry System | Chloramphenicol sodium succinate (982-57-0) |
| Hazard Codes | Xn | | Risk Statements | 40 | | Safety Statements | 22-36 | | WGK Germany | 3 | | RTECS | AB6905000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Carc. 2 |
| | Chloramphenicol sodium succinate Usage And Synthesis |
| Chemical Properties | White or yellowish-white powder, hygroscopic | | Uses | Chloramphenicol Succinate Sodium is a derivative of Chloramphenicol (C325030) which are broad spectrum antibiotic obtained from cultures of the soil bacterium Streptomyces venezuelae. It has a broad spectrum of activity against Gram-positive and gram-negative bacteria. Antibacterial; antirickettsial. | | Uses | antibacterial, antirickettsial, inhibits protein synthesis | | Uses | Chloramphenicol succinate sodium is the salt prepared from chloramphenicol succinate using the free carboxylic acid of the succinate which ionises and readily forms in weakly sodium hydroxide solutions. The sodium salt is the preferred formulation for pharmaceutical applications, providing a more readily soluble product. Chloramphenicol succinate is significantly less active than chloramphenicol but acts as a prodrug, forming chloramphenicol in the presence of succinate dehydrogenase. | | General Description | White powder. | | General Description | Chloramphenicol sodium succinate is the water-solublesodium salt of the hemisuccinate ester of chloramphenicol.Because of the low solubility of chloramphenicol, the sodiumsuccinate is preferred for intravenous administration. Theavailability of chloramphenicol from the ester followingintravenous administration is estimated to be 70% to 75%; theremainder is excreted unchanged. Poor availability ofthe active form from the ester following intramuscular injectionprecludes attaining effective plasma levels of the antibioticby this route. Orally administered chloramphenicol orits palmitate ester actually gives higher plasma levels of theactive antibiotic than does intravenously administered chloramphenicolsodium succinate. Nonetheless, effectiveconcentrations are achieved by either route. | | Air & Water Reactions | Freely soluble in water. | | Fire Hazard | Flash point data for Chloramphenicol sodium succinate are not available, but Chloramphenicol sodium succinate is probably combustible. |
| | Chloramphenicol sodium succinate Preparation Products And Raw materials |
|