| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:4-Phenylbenzaldoxime CAS:40143-27-9 Purity:analytical standard Package:1G Remarks:P5251-1G
|
|
| | 4-BIPHENYLALDEHYDE OXIME Basic information |
| | 4-BIPHENYLALDEHYDE OXIME Chemical Properties |
| Melting point | 142-147 °C | | Boiling point | 334.8±21.0 °C(Predicted) | | density | 1.05±0.1 g/cm3(Predicted) | | pka | 10.66±0.10(Predicted) | | Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary | | InChI | 1S/C13H11NO/c15-14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-10,15H/b14-10+ | | InChIKey | OUNAWNXTMKAPFT-GXDHUFHOSA-N | | SMILES | O\N=C\c1ccc(cc1)-c2ccccc2 |
| WGK Germany | 3 | | HS Code | 2929900090 | | Storage Class | 11 - Combustible Solids |
| | 4-BIPHENYLALDEHYDE OXIME Usage And Synthesis |
| Uses | 4-Phenylbenzaldoxime is a reactant in the design and synthesis of substituted-isoxazole derivatives as farnesoid X receptor (FXR) antagonists. |
| | 4-BIPHENYLALDEHYDE OXIME Preparation Products And Raw materials |
|