- 4-Bromo-2,6-difluoroanisole
-
- $15.00 / 1KG
-
2021-08-12
- CAS:104197-14-0
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 4-Bromo-2,6-difluoroanisole Basic information |
| Product Name: | 4-Bromo-2,6-difluoroanisole | | Synonyms: | 4-BROMO-2,6-DIFLUOROANISOLE;4-Bromo-2,6-difluoroanisole, 97+%;4-Bromo-2,6-difluoroanisole 98%;4-Bromo-2,6-difluoroanisole98%;4-bromo-2,6-difluorophenyl methyl ether;5-bromo-1,3-difluoro-2-methoxybenzene;4-Bromo-2,6-difluorophenyl methyl ether, 5-Bromo-1,3-difluoro-2-methoxybenzene;4-Bromo-2,6-difluoroanisole > | | CAS: | 104197-14-0 | | MF: | C7H5BrF2O | | MW: | 223.01 | | EINECS: | | | Product Categories: | | | Mol File: | 104197-14-0.mol |  |
| | 4-Bromo-2,6-difluoroanisole Chemical Properties |
| Boiling point | 80-100°C 15mm | | density | 1.65 | | Fp | 80-100°C/15mm | | refractive index | 1.5100 | | storage temp. | Sealed in dry,2-8°C | | form | clear liquid | | color | Light yellow to Brown | | Water Solubility | Insoluble in water. | | Sensitive | Light Sensitive | | InChI | InChI=1S/C7H5BrF2O/c1-11-7-5(9)2-4(8)3-6(7)10/h2-3H,1H3 | | InChIKey | CDOQKISJPOWBKC-UHFFFAOYSA-N | | SMILES | C1(F)=CC(Br)=CC(F)=C1OC | | CAS DataBase Reference | 104197-14-0(CAS DataBase Reference) |
| Hazard Codes | Xi,F | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | HazardClass | IRRITANT | | HS Code | 2909303890 |
| Provider | Language |
|
ALFA
| English |
| | 4-Bromo-2,6-difluoroanisole Usage And Synthesis |
| Chemical Properties | light yellow liquid | | Uses | t is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuffs. |
| | 4-Bromo-2,6-difluoroanisole Preparation Products And Raw materials |
|