|
|
| | ADIPIC ACID DIBENZYL ESTER Basic information |
| Product Name: | ADIPIC ACID DIBENZYL ESTER | | Synonyms: | DIBENZYL ADIPATE;ADIPIC ACID DIBENZYL ESTER;Dibenzyl hexanedioate;Dibenzyladecyldisulphide;hexanedioicacid,bis(phenylmethyl)ester;Adipicaciddibenzylester95+%;Hexanedioic acid dibenzyl ester;adipic acid bis(benzyl) ester | | CAS: | 2451-84-5 | | MF: | C20H22O4 | | MW: | 326.39 | | EINECS: | 219-516-4 | | Product Categories: | | | Mol File: | 2451-84-5.mol |  |
| | ADIPIC ACID DIBENZYL ESTER Chemical Properties |
| Melting point | 34.0 to 37.0 °C | | Boiling point | 202-208 °C(Press: 0.3 Torr) | | density | 1.0903 g/cm3 | | Fp | 36 °C | | storage temp. | Sealed in dry,Room Temperature | | form | powder to lump to clear liquid | | color | White or Colorless to Light yellow | | InChI | InChI=1S/C20H22O4/c21-19(23-15-17-9-3-1-4-10-17)13-7-8-14-20(22)24-16-18-11-5-2-6-12-18/h1-6,9-12H,7-8,13-16H2 | | InChIKey | AEUORZZHALJMBM-UHFFFAOYSA-N | | SMILES | C(OCC1=CC=CC=C1)(=O)CCCCC(OCC1=CC=CC=C1)=O | | CAS DataBase Reference | 2451-84-5 | | EPA Substance Registry System | Hexanedioic acid, bis(phenylmethyl) ester (2451-84-5) |
| TSCA | TSCA listed | | HS Code | 2917.12.5000 |
| | ADIPIC ACID DIBENZYL ESTER Usage And Synthesis |
| Uses | Dibenzyl Adipate is used as a plasticiser. |
| | ADIPIC ACID DIBENZYL ESTER Preparation Products And Raw materials |
|