- 3-Bromopropionyl chloride
-
- $15.00 / 1KG
-
2021-08-12
- CAS:15486-96-1
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 3-Bromopropionyl chloride Basic information |
| | 3-Bromopropionyl chloride Chemical Properties |
| Boiling point | 55-57 °C/17 mmHg (lit.) | | density | 1.701 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.49(lit.) | | Fp | 175 °F | | storage temp. | 2-8°C | | form | Liquid | | color | Clear yellow | | Water Solubility | REACTS | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C3H4BrClO/c4-2-1-3(5)6/h1-2H2 | | InChIKey | IHBVNSPHKMCPST-UHFFFAOYSA-N | | SMILES | C(Cl)(=O)CCBr | | CAS DataBase Reference | 15486-96-1(CAS DataBase Reference) | | EPA Substance Registry System | Propanoyl chloride, 3-bromo- (15486-96-1) |
| Hazard Codes | C | | Risk Statements | 34-36/37 | | Safety Statements | 23-26-27-36/37/39-45-25 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29159000 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B STOT SE 3 |
| | 3-Bromopropionyl chloride Usage And Synthesis |
| Chemical Properties | clear yellow liquid | | Uses | 3-Bromopropionyl chloride was used in the preparation of 1-chloro-4-bromo-2-butanone. | | General Description | 3-Bromopropionyl chloride reacts with poly(ethylene glycol) methacrylate to yield brominated poly(ethylene glycol) methacrylate. It causes the acylation of 4-aryl-substituted 3,4-di-hydropyrimidine(1H)-2-thiones to give bicyclic pyrimido[2,1-b][1,3]thiazines. |
| | 3-Bromopropionyl chloride Preparation Products And Raw materials |
|