|
|
| | 2-Methoxy-5-(trifluoromethyl)pyridine Basic information |
| | 2-Methoxy-5-(trifluoromethyl)pyridine Chemical Properties |
| Melting point | 161C | | Boiling point | 166.6±40.0 °C(Predicted) | | density | 1.297g/cm | | refractive index | 1.4320-1.4360 | | storage temp. | Inert atmosphere,Room Temperature | | pka | 0.97±0.10(Predicted) | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C7H6F3NO/c1-12-6-3-2-5(4-11-6)7(8,9)10/h2-4H,1H3 | | InChIKey | KNIGTEGBOBDGKP-UHFFFAOYSA-N | | SMILES | C1(OC)=NC=C(C(F)(F)F)C=C1 | | CAS DataBase Reference | 175277-45-9(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 2-Methoxy-5-(trifluoromethyl)pyridine Usage And Synthesis |
| Uses | 2-Methoxy-5-trifluoromethylpyridine |
| | 2-Methoxy-5-(trifluoromethyl)pyridine Preparation Products And Raw materials |
|