|
|
| | 16alpha-Hydroxyprednisonlone acetate Basic information | | 用途 |
| Product Name: | 16alpha-Hydroxyprednisonlone acetate | | Synonyms: | 16A-HYDROXY-PREDNISONLONE ACETATE;16α-Hydroxyprednisolone acetate;Pregna-1,4-diene-3,20-dione,21-(acetyloxy)-11,16,17-trihydroxy-, (11b,16a)-;16alpha-hydroxyprednisonlone acetate;11b,16a,17,21-tetrahydroxy-pregna-1,4-diene-3,20-dione 21-acetate;16ALPHA-HYDROXYPRENISOLONEACETATE;16α-HYDROXY-PREDNISONLONEACETATE;16alpha-Hydroxy-prednisolone acetate | | CAS: | 86401-80-1 | | MF: | C23H30O7 | | MW: | 418.49 | | EINECS: | 812-027-2 | | Product Categories: | Pharmaceutical Intermediates;Pharmaceutical Raw Materials | | Mol File: | 86401-80-1.mol |  |
| | 16alpha-Hydroxyprednisonlone acetate Chemical Properties |
| Boiling point | 599.4±50.0 °C(Predicted) | | density | 1.34 | | storage temp. | 2-8°C | | pka | 11.88±0.70(Predicted) | | InChIKey | AAMGSJIEPUHTOK-AVBIOXLONA-N | | SMILES | C[C@]12C[C@H](O)[C@]3([H])[C@]4(C=CC(=O)C=C4CC[C@@]3([H])[C@]1([H])C[C@@H](O)[C@]2(O)C(=O)COC(=O)C)C |&1:1,3,5,7,16,18,21,23,r| |
| | 16alpha-Hydroxyprednisonlone acetate Usage And Synthesis |
| 用途 | 16α-Hydroxyprednisolone Acetate is used to observe interaction of some steroid drugs with β-cyclodextrin polymer to calculate the relative strengh of interaction between the hydrophobicity parameters of the drugs and the strenght of the drug-β-cyclodextrin polymer. | | Uses | 16α-Hydroxyprednisolone Acetate is used to observe interaction of some steroid drugs with β-cyclodextrin polymer to calculate the relative strengh of interaction between the hydrophobicity parameters of the drugs and the strenght of the drug-β-cyclodextrin polymer. |
| | 16alpha-Hydroxyprednisonlone acetate Preparation Products And Raw materials |
|