|
|
| | TRANS-1,4-CYCLOHEXANEDIOL Basic information |
| Product Name: | TRANS-1,4-CYCLOHEXANEDIOL | | Synonyms: | TRANS-1,4-CYCLOHEXANEDIOL;trans-1,4-Dihydroxycyclohexane;trans-4-cyclohexanediol;trans-Hexahydrohydroquinone;trans-Quinitol;(1r,4r)-cyclohexane-1,4-diol;trans-Cyclohexane-1,4-diol;1,4-Cyclohexanediol,trans- | | CAS: | 6995-79-5 | | MF: | C6H12O2 | | MW: | 116.16 | | EINECS: | | | Product Categories: | | | Mol File: | 6995-79-5.mol |  |
| | TRANS-1,4-CYCLOHEXANEDIOL Chemical Properties |
| Melting point | 141-142 ºC | | Boiling point | 252 ºC | | density | 1.156 | | refractive index | 1.4270 (estimate) | | Fp | 66 ºC | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 14.75±0.40(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C6H12O2/c7-5-1-2-6(8)4-3-5/h5-8H,1-4H2/t5-,6- | | InChIKey | VKONPUDBRVKQLM-IZLXSQMJSA-N | | SMILES | [C@@H]1(O)CC[C@@H](O)CC1 | | CAS DataBase Reference | 6995-79-5 | | EPA Substance Registry System | 1,4-Cyclohexanediol, trans- (6995-79-5) |
| TSCA | TSCA listed | | HS Code | 2906190090 |
| | TRANS-1,4-CYCLOHEXANEDIOL Usage And Synthesis |
| Uses | trans-1,4-cyclohexanediol is used as a liquid crystal material intermediates and organic synthesis intermediates. | | Purification Methods | Crystallise the trans-diol from MeOH or Me2CO. The diacetate has m 104.5-105o (from pet ether or 102-103o from EtOH). [Grob & Baumann Helv Chim Acta 38 604 1955, Owen & Robins J Chem Soc 320 1949, Beilstein 6 III 4080, 6 IV 5209.] |
| | TRANS-1,4-CYCLOHEXANEDIOL Preparation Products And Raw materials |
|