| Company Name: |
Zhengzhou Alfachem Co.,Ltd. Gold
|
| Tel: |
0371-53778726 18003825608 |
| Email: |
liuxiaoyan@alfachem.cn |
| Products Intro: |
Product Name:2-azido terephthalic acid CAS:3600-74-6 Purity:98% Package:25g;100g;500g;1kg;5kg
|
|
| | 2-azido terephthalic acid Basic information |
| | 2-azido terephthalic acid Chemical Properties |
| Melting point | 220 °C (decomp) | | InChI | InChI=1S/C8H5N3O4/c9-11-10-6-3-4(7(12)13)1-2-5(6)8(14)15/h1-3H,(H,12,13)(H,14,15) | | InChIKey | IUGMVBUDECYPGB-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)=CC=C(C(O)=O)C=C1N=[N+]=[N-] |
| | 2-azido terephthalic acid Usage And Synthesis |
| | 2-azido terephthalic acid Preparation Products And Raw materials |
|