|
|
| | Cyclo(-D-Leu-D-Pro) Basic information |
| Product Name: | Cyclo(-D-Leu-D-Pro) | | Synonyms: | Pyrrolo[1,2-a]pyrazine-1,4-dione, hexahydro-3-(2-methylpropyl)-, (3R,8aR)-;Cyclo(D-leucyl-D-prolyl);cyclo-(R-pro-R-leu);c(DPro-DLeu);Cyclo(-D-Leu-D-Pro) | | CAS: | 274680-11-4 | | MF: | C11H18N2O2 | | MW: | 210.27 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | Cyclo(-D-Leu-D-Pro) Chemical Properties |
| Boiling point | 427.6±34.0 °C(Predicted) | | density | 1.14±0.1 g/cm3(Predicted) | | storage temp. | -15°C | | pka | 13.27±0.40(Predicted) | | form | Solid | | color | White to off-white | | Sequence | Cyclo({d-Leu}-{d-Pro}) | | InChI | InChI=1S/C11H18N2O2/c1-7(2)6-8-11(15)13-5-3-4-9(13)10(14)12-8/h7-9H,3-6H2,1-2H3,(H,12,14)/t8-,9-/m1/s1 | | InChIKey | SZJNCZMRZAUNQT-RKDXNWHRSA-N | | SMILES | [C@]12([H])CCCN1C(=O)[C@@H](CC(C)C)NC2=O |
| | Cyclo(-D-Leu-D-Pro) Usage And Synthesis |
| Uses | Cyclo(D-Leu-D-Pro) is a polypeptide that can be found by peptide screening. Peptide screening is a research tool that pools active peptides primarily by immunoassay. Peptide screening can be used for protein interaction, functional analysis, epitope screening, especially in the field of agent research and development[1]. | | References | [1] Birnbaum S, et al. Peptide screening. Current Opinion in Biotechnology, 1992, 3(1): 49-54. |
| | Cyclo(-D-Leu-D-Pro) Preparation Products And Raw materials |
|