|
|
| | 2-CHLORO-6-FLUORO-3-METHYLBENZOIC ACID Basic information |
| Product Name: | 2-CHLORO-6-FLUORO-3-METHYLBENZOIC ACID | | Synonyms: | RARECHEM AL BE 0495;2-Chloro-6-fluoro-m-toluic acid;3-Carboxy-2-chloro-4-fluorotoluene, 2-Chloro-6-fluoro-m-toluic acid;2-CHLORO-6-FLUORO-3-METHYLBENZOIC ACID;Benzoic acid, 2-chloro-6-fluoro-3-methyl- | | CAS: | 32890-89-4 | | MF: | C8H6ClFO2 | | MW: | 188.58 | | EINECS: | 630-021-6 | | Product Categories: | | | Mol File: | 32890-89-4.mol |  |
| | 2-CHLORO-6-FLUORO-3-METHYLBENZOIC ACID Chemical Properties |
| Melting point | 116-118°C | | Boiling point | 278.1±35.0 °C(Predicted) | | density | 1.403±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 2.15±0.25(Predicted) | | BRN | 2259104 | | InChI | InChI=1S/C8H6ClFO2/c1-4-2-3-5(10)6(7(4)9)8(11)12/h2-3H,1H3,(H,11,12) | | InChIKey | VCNCNVOMGXWTBZ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=C(F)C=CC(C)=C1Cl | | CAS DataBase Reference | 32890-89-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | HazardClass | IRRITANT | | HS Code | 2916399090 |
| Provider | Language |
|
ALFA
| English |
| | 2-CHLORO-6-FLUORO-3-METHYLBENZOIC ACID Usage And Synthesis |
| Uses | 2-Chloro-6-fluoro-3-methylbenzoic acid can be used as a drug synthesis intermediate. Literature reports that it can be used to synthesize stearoyl-CoA desaturase 1 (SCD1) inhibitors for the treatment of obesity and other diseases. |
| | 2-CHLORO-6-FLUORO-3-METHYLBENZOIC ACID Preparation Products And Raw materials |
|