| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]acetamide Basic information |
| Product Name: | N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]acetamide | | Synonyms: | N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]acetamide;Acetamide, N-[2-(4-methoxybenzoyl)-3-benzofuranyl]-;N-(2-(4-methoxybenzoyl)benzofuran-3-yl)acetamide;Inhibitor,inhibit,ATPase,p97,fibroblast,cancer,NPD 8733,NPD8733,VCP,migration,NPD-8733;NPD8733, 10 mM in DMSO;NPD8733 | | CAS: | 696655-62-6 | | MF: | C18H15NO4 | | MW: | 309.32 | | EINECS: | | | Product Categories: | | | Mol File: | 696655-62-6.mol | ![N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]acetamide Structure](CAS/20180719/GIF/696655-62-6.gif) |
| | N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]acetamide Chemical Properties |
| storage temp. | 2-8°C | | solubility | DMSO: 2mg/mL, clear | | form | powder | | color | white to beige | | InChI | 1S/C18H15NO4/c1-11(20)19-16-14-5-3-4-6-15(14)23-18(16)17(21)12-7-9-13(22-2)10-8-12/h3-10H,1-2H3,(H,19,20) | | InChIKey | NQZBUYPGHZTWIR-UHFFFAOYSA-N | | SMILES | N(c1c2c([o]c1C(=O)c3ccc(cc3)OC)cccc2)C(=O)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]acetamide Usage And Synthesis |
| Description | NPD8733 is an inhibitor of cancer cell-enhanced fibroblast migration. NPD8733 specifically binds to valosin-containing protein (VCP)/p97 | | Uses | NPD8733 is an inhibitor of cancer cell-enhanced fibroblast migration. NPD8733 specifically binds to valosin-containing protein (VCP)/p97, a member of the ATPase-associated with diverse cellular activities (AAA+) protein family. NPD8733 has the potential for the research of cancer diseases[1]. | | References | [1] Suvarna K, et al. A small-molecule ligand of valosin-containing protein/p97 inhibits cancer cell-accelerated fibroblast migration. J Biol Chem. 2019;294(9):2988-2996. DOI:10.1074/jbc.RA118.004741 |
| | N-[2-(4-methoxybenzoyl)-1-benzofuran-3-yl]acetamide Preparation Products And Raw materials |
|