Nalidixic acid sodium salt manufacturers
|
| | Nalidixic acid sodium salt Basic information |
| Product Name: | Nalidixic acid sodium salt | | Synonyms: | NALIDIXIC ACID SODIUM SALT;1-ethyl-1,4-dihydro-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylicacidsodium;8-naphthyridine-3-carboxylicacid,1-ethyl-1,4-dihydro-7-methyl-4-oxo-sodiu;1-ETHYL-1,4-DIHYDRO-7-METHYL-4-OXO-1,8-NAPHTHYRIDINE-3-CARBOXYLIC ACID SODIUM SALT;nalidixatesodium;sodiumnalidixate;sodiumnilixalate;sodium 1-ethyl-1,4-dihydro-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate | | CAS: | 3374-05-8 | | MF: | C12H13N2NaO3 | | MW: | 256.24 | | EINECS: | 222-159-7 | | Product Categories: | CEBESINE;antibiotic | | Mol File: | 3374-05-8.mol |  |
| | Nalidixic acid sodium salt Chemical Properties |
| Melting point | >280℃ | | storage temp. | Inert atmosphere,Room Temperature | | solubility | H2O: 50 mg/mL, clear, faintly yellow | | form | powder | | color | White to off-white | | Water Solubility | Soluble at 50mg/ml in water | | BRN | 3580062 | | InChI | InChI=1S/C12H12N2O3.Na.H/c1-3-14-6-9(12(16)17)10(15)8-5-4-7(2)13-11(8)14;;/h4-6H,3H2,1-2H3,(H,16,17);; | | InChIKey | XVRRVENPZKMSNF-UHFFFAOYSA-N | | SMILES | C(N1C=C(C(=O)O)C(=O)C2=CC=C(C)N=C12)C.[NaH] | | CAS DataBase Reference | 3374-05-8(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 42/43 | | Safety Statements | 22-36/37-45 | | WGK Germany | - | | RTECS | QN2885500 | | F | 8-10 | | HS Code | 29339900 |
| | Nalidixic acid sodium salt Usage And Synthesis |
| Uses | anesthetic (local) | | Uses | Nalidixic acid sodium salt is an antibacterial agent, which is inhibitor of bacterial DNA polymerase & avian myeloblastoma virus reverse transcriptase. The compound inhibits nucleic acid and protein synthesis in Saccharomyces cerevisiae. | | General Description | Chemical structure: quinolone | | Biochem/physiol Actions | Nalidixic acid sodium salt is an inhibitor of bacterial DNA polymerase (DNA gyrase) and avian myeloblastoma virus reverse transcriptase. Inhibits nucleic acid and protein synthesis in Saccharomyces cerevisiae. |
| | Nalidixic acid sodium salt Preparation Products And Raw materials |
|