- Gly-Phe
-
-
2026-08-21
- CAS:3321-03-7
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | GLYCYL-L-PHENYLALANINE Basic information |
| | GLYCYL-L-PHENYLALANINE Chemical Properties |
| Melting point | ~264 °C (dec.) | | Boiling point | 492.2±45.0 °C(Predicted) | | density | 1.259±0.06 g/cm3(Predicted) | | refractive index | 41 ° (C=2, H2O) | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | solubility | DMSO (Slightly, Heated), Water (Slightly, Sonicated) | | form | powder to crystal | | pka | 3.28±0.10(Predicted) | | color | White to Almost white | | Optical Rotation | Consistent with structure | | Water Solubility | almost transparency | | InChI | 1S/C11H14N2O3/c12-7-10(14)13-9(11(15)16)6-8-4-2-1-3-5-8/h1-5,9H,6-7,12H2,(H,13,14)(H,15,16)/t9-/m0/s1 | | InChIKey | JBCLFWXMTIKCCB-VIFPVBQESA-N | | SMILES | NCC(=O)N[C@@H](Cc1ccccc1)C(O)=O | | CAS DataBase Reference | 3321-03-7(CAS DataBase Reference) |
| WGK Germany | 3 | | F | 8 | | HS Code | 2924.29.9500 | | Storage Class | 11 - Combustible Solids |
| | GLYCYL-L-PHENYLALANINE Usage And Synthesis |
| Chemical Properties | Crystalline | | Uses | Glycyl-DL-phenylalanine is used in methods and composition for spacial and temporal measurement of catalytic activity. | | Definition | ChEBI: A dipeptide formed from glycine and L-phenylalanine residues. | | IC 50 | Human Endogenous Metabolite |
| | GLYCYL-L-PHENYLALANINE Preparation Products And Raw materials |
|