- 2-AMINO-4-METHYLOXAZOLE
-
- $15.00 / 1KG
-
2021-08-12
- CAS:35629-70-0
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 2-AMINO-4-METHYLOXAZOLE Basic information |
| | 2-AMINO-4-METHYLOXAZOLE Chemical Properties |
| Boiling point | 67-69°C 0,5mm | | density | 1.1890 (rough estimate) | | refractive index | 1.4327 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | form | liquid | | pka | 5.80±0.10(Predicted) | | color | Yellow | | InChI | InChI=1S/C4H6N2O/c1-3-2-7-4(5)6-3/h2H,1H3,(H2,5,6) | | InChIKey | VCZJVXLWQTXSPQ-UHFFFAOYSA-N | | SMILES | O1C=C(C)N=C1N | | CAS DataBase Reference | 35629-70-0(CAS DataBase Reference) |
| | 2-AMINO-4-METHYLOXAZOLE Usage And Synthesis |
| Chemical Properties | Colorless to yellow solid | | Synthesis Reference(s) | Journal of Medicinal Chemistry, 14, p. 1075, 1971 DOI: 10.1021/jm00293a014 |
| | 2-AMINO-4-METHYLOXAZOLE Preparation Products And Raw materials |
|