|
|
| | Amine:oxygen oxidoreductase [deaminating] Basic information |
| Product Name: | Amine:oxygen oxidoreductase [deaminating] | | Synonyms: | PLASMA AMINE OXIDASE FROM BOVINE PLASMA;PAO;amine oxidase, flavin-containing;plasma amine oxidase from bovine plasma;tyramine oxidase from arthrobacter*species;Oxidase, monoamine;YRAMINE OXIDASE FROM ARTHROBACTER &;tyramine oxidase from arthrobacter sp.;SSAO | | CAS: | 9001-66-5 | | MF: | C7H15N2O6P | | MW: | 254.177561 | | EINECS: | 232-623-0 | | Product Categories: | | | Mol File: | 9001-66-5.mol | ![Amine:oxygen oxidoreductase [deaminating] Structure](CAS/20180808/GIF/9001-66-5.gif) |
| | Amine:oxygen oxidoreductase [deaminating] Chemical Properties |
| density | 0.319[at 20℃] | | vapor pressure | 0Pa at 25℃ | | storage temp. | 2-8°C | | form | lyophilized powder | | color | White to off-white | | biological source | human | | Water Solubility | 102g/L at 30℃ | | InChI | InChI=1/C7H15N2O6P/c8-5(7(11)12)2-1-3-9-6(10)4-16(13,14)15/h5H,1-4,8H2,(H,9,10)(H,11,12)(H2,13,14,15)/t5-/s3 | | InChIKey | FCIHAQFHXJOLIF-GQMHJJTINA-N | | SMILES | C(O)(=O)[C@@H](N)CCCNC(CP(O)(O)=O)=O |&1:3,r| | | LogP | -3 at 23℃ | | CAS DataBase Reference | 9001-66-5 |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | Amine:oxygen oxidoreductase [deaminating] Usage And Synthesis |
| Uses | Monoamine oxidase (EC 1.4.3.4) is an enzyme composed of different polypeptides. Monoamine oxidation catalyzes the oxidative deamination of various biological amines in brain and peripheral tissues by producing hydrogen peroxide. Monoamine oxidase plays an important role in maintaining the regulation of synaptic transmission, emotional behavior and other brain functions[1][2]. | | Definition | An enzyme that is distributedwidely among animals. It inactivates a number ofbiogenic amines by catalyzing the oxidative deam-ination of these compounds. | | Flammability and Explosibility | Not classified | | Biological Activity | The protein VAP-1 (vascular adhesion protein-1) belongs to the group of semicarbazide sensitive amine oxidases (SSAO) th at catalyze the formation of reactive oxygen species. It is a unique adhesion molecule th at participates in inflammatory leukocyte recruitment in blood vessels. It functions in leukocyte extravasation to inflamed tissues. In the human eye, it has been associated with ocular inflammatory diseases, such as uveitis, age-related macular degeneration, and diabetic retinopathy. Its expression has been observed to be altered in several diseases, such as rheumatoid arthritis, diabetes, and atherosclerosis. | | References | [1] Shih JC, et al. Monoamine oxidase: from genes to behavior. Annu Rev Neurosci. 1999;22:197-217. DOI:10.1146/annurev.neuro.22.1.197
[2] Bortolato M, et al. Monoamine oxidase inactivation: from pathophysiology to therapeutics. Adv Drug Deliv Rev. 2008 Oct-Nov;60(13-14):1527-33. DOI:10.1016/j.addr.2008.06.002
[3] Youdim MB, et al. The therapeutic potential of monoamine oxidase inhibitors. Nat Rev Neurosci. 2006 Apr;7(4):295-309. DOI:10.1038/nrn1883 |
| | Amine:oxygen oxidoreductase [deaminating] Preparation Products And Raw materials |
|