|
|
| | HEPTADECANEDIOIC ACID Basic information |
| | HEPTADECANEDIOIC ACID Chemical Properties |
| Melting point | 121 °C | | Boiling point | 170-190 °C(Press: 0.3 Torr) | | density | 1.006±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.48±0.10(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C17H32O4/c18-16(19)14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17(20)21/h1-15H2,(H,18,19)(H,20,21) | | InChIKey | QCNWZROVPSVEJA-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCCCCCCCCCCCCCC(O)=O | | CAS DataBase Reference | 2424-90-0 | | EPA Substance Registry System | Heptadecanedioic acid (2424-90-0) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | TSCA | TSCA listed | | HS Code | 2915.90.5050 |
| | HEPTADECANEDIOIC ACID Usage And Synthesis |
| Definition | ChEBI: Heptadecanedioic acid is a long-chain fatty acid. |
| | HEPTADECANEDIOIC ACID Preparation Products And Raw materials |
|