- Fosfomycin calcium
-
- $0.00 / 25Kg/Drum
-
2026-01-23
- CAS:26016-98-8
- Min. Order: 1KG
- Purity: 95%-101% EP
- Supply Ability: 500kg
- Fosfomycin calcium
-
- $33.00 / 100mg
-
2026-01-20
- CAS:26016-98-8
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| | Phosphomycin calcium salt Basic information |
| Product Name: | Phosphomycin calcium salt | | Synonyms: | (1,2-epoxypropyl)-,calciumsalt(1:1),(1r,2s)-(-)-phosphonicaci;(3-methyloxiranyl)-,calciumsalt(1:1),(2r-cis)-phosphonicaci;calciumfosfomycin;calciumphosphomycin;calciumphosphonomycin;fosmicin;PHOSPHOMYCIN;PHOSPHOMYCIN CALCIUM SALT MONOHYDRATE | | CAS: | 26016-98-8 | | MF: | C3H9CaO4P | | MW: | 180.15 | | EINECS: | 247-408-7 | | Product Categories: | chiral;Drug bulk;API | | Mol File: | 26016-98-8.mol |  |
| | Phosphomycin calcium salt Chemical Properties |
| storage temp. | Inert atmosphere,2-8°C | | solubility | 1 M HCl: soluble50mg/mL | | form | Solid | | color | White to off-white | | InChI | InChI=1/C3H7O4P.Ca.2H/c1-2-3(7-2)8(4,5)6;;;/h2-3H,1H3,(H2,4,5,6);;;/t2-,3+;;;/s3 | | InChIKey | YMZJBJPWTXJQMR-MUWMCQJSSA-L | | SMILES | P([C@H]1O[C@H]1C)(O)(O)=O.[Ca] |&1:1,3,r| | | CAS DataBase Reference | 26016-98-8(CAS DataBase Reference) |
| WGK Germany | 2 | | RTECS | SZ7895000 |
| | Phosphomycin calcium salt Usage And Synthesis |
| Uses | Fosfomycin Calcium is a bacterial wall synthesis inhibitor. | | Definition | ChEBI: Fosfomycin calcium is an organic molecular entity. | | in vivo | Fosfomycin calcium (80 mg/kg; i.v.-i.v. or i.v.-p.o.) displays the protective effect on the nephrotoxicity of double beckacin, and is not affected by different administration routes[3].
Pharmacokinetic of Fosfomycin calcium in Rats[4]
| Dibekacin Dose (mg) | Vdss (l/kg) | β (min-1) | T1/2 (min) | Urinary recovery (%) | | 30 | 0.261 | 0.0244 | 28.4 | 85 |
| Animal Model: | Fischer 344 rats[3] | | Dosage: | 320 mg/kg | | Administration: | Intramuscular injection, 5 schedules: 1 h, 0.5 h earlier than dibekacin, concomitantly, 0.5 h later and 1 h later; 11 days | | Result: | Reduced polyuria, proteinuria, enzymes and cytosine caused by dibecacin (40 mg/kg), followed by the previous treatment.
|
| Animal Model: | Dehydrated Wistar rat with acute renal failure (8-week-old)[4] | | Dosage: | 120 mg/kg | | Administration: | Intravenous injection; once | | Result: | Recovered the exclusion rate of rats basically to normal, and improved the nephrotoxicity parameters.
Protects proximal tubular lysosomes from aminoglycosides by inhibiting myeloid formation and protecting the integrity of lysosomal membrane of rats treated with double bekacin.
|
|
| | Phosphomycin calcium salt Preparation Products And Raw materials |
|