| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | HYDRAZINE HYDRATE-D6 Basic information |
| | HYDRAZINE HYDRATE-D6 Chemical Properties |
| Melting point | -51.7 °C(lit.) | | Boiling point | 120.1 °C(lit.) | | density | 1.156 g/mL at 25 °C | | refractive index | n20/D 1.428 | | Fp | 165 °F | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | Stability: | Hygroscopic | | InChI | 1S/H4N2.H2O/c1-2;/h1-2H2;1H2/i/hD6 | | InChIKey | IKDUDTNKRLTJSI-YIKVAAQNSA-N | | SMILES | [2H]O[2H].[2H]N([2H])N([2H])[2H] |
| Hazard Codes | T,N | | Risk Statements | 45-10-23/24/25-34-43-50/53 | | Safety Statements | 53-45-60-61 | | RIDADR | UN 2030 8/PG 2 | | WGK Germany | 3 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Inhalation
Acute Tox. 3 Dermal
Acute Tox. 3 Oral
Aquatic Acute 1
Aquatic Chronic 1
Carc. 1B
Eye Dam. 1
Skin Corr. 1B
Skin Sens. 1 |
| | HYDRAZINE HYDRATE-D6 Usage And Synthesis |
| Uses | HYDRAZINE HYDRATE-D6 is used as a reactant in the cyclizations of pyridinones. It is also used in the study of nanocrystal semiconductors, participating in the functionalization and passivation of surface states. |
| | HYDRAZINE HYDRATE-D6 Preparation Products And Raw materials |
|