- L-Threoninol
-
-
2026-03-20
- CAS:3228-51-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20 mt
- H-Threoninol
-
- $1.00
-
2019-07-06
- CAS:3228-51-1
- Min. Order: 1kg
- Purity: 95%-99%
- Supply Ability: 1000kg
|
| | L-Threoninol Basic information |
| Product Name: | L-Threoninol | | Synonyms: | 1,3-BUTANEDIOL, 2-AMINO-, (2R,3R)-;L(+)-Threoninol,97%;(2S,3S)-2-Amino-1,3-butanediol;L-Threoninol,(2R,3R)-2-Amino-1,3-butanediol;(2R,3R)-2-AMinobutane-1,3-diol;L-Threoninol 97%;L-Threonol;L-Thr-ol | | CAS: | 3228-51-1 | | MF: | C4H11NO2 | | MW: | 105.14 | | EINECS: | | | Product Categories: | Amino Alcohols;Amino alcohols | | Mol File: | 3228-51-1.mol |  |
| | L-Threoninol Chemical Properties |
| Melting point | 49-54 °C (lit.) | | alpha | 6.5 º (c=1, EtOH) | | Boiling point | 120 °C | | density | 1.118±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Water (Sparingly) | | form | Oil | | pka | 12.61±0.45(Predicted) | | color | Light Yellow | | Optical Rotation | [α]20/D 4.2°, c = 1% in H2O | | Water Solubility | Soluble | | BRN | 6130524 | | Major Application | peptide synthesis | | InChI | InChI=1S/C4H11NO2/c1-3(7)4(5)2-6/h3-4,6-7H,2,5H2,1H3/t3-,4-/m1/s1 | | InChIKey | MUVQIIBPDFTEKM-QWWZWVQMSA-N | | SMILES | C(O)[C@@H](N)[C@H](O)C | | CAS DataBase Reference | 3228-51-1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-36/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | F | 3-10 | | HS Code | 29221985 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 |
| | L-Threoninol Usage And Synthesis |
| Chemical Properties | white crystalline solid | | Uses | L-Threoninol can be used as artificial abasic nucleoside in the synthesis and modification of oligodeoxynucleotide and can also be utilized to synthesize pyrene-L-threoninyl analogues. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | L-Threoninol Preparation Products And Raw materials |
|