- 2,6-Difluorobenzyl bromide
-
- $100.00 / 1KG
-
2025-09-25
- CAS:85118-00-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2,6-Difluorobenzyl bromide Basic information |
| | 2,6-Difluorobenzyl bromide Chemical Properties |
| Melting point | 52-55 °C(lit.) | | Boiling point | 184.9±25.0 °C(Predicted) | | density | 1,6 g/cm3 | | refractive index | 1.5256 (estimate) | | Fp | >230 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | soluble in Methanol | | form | Crystalline Powder | | color | Almost white to light beige | | Sensitive | Lachrymatory | | BRN | 2083943 | | InChI | InChI=1S/C7H5BrF2/c8-4-5-6(9)2-1-3-7(5)10/h1-3H,4H2 | | InChIKey | LSXJPJGBWSZHTM-UHFFFAOYSA-N | | SMILES | C1(F)=CC=CC(F)=C1CBr | | CAS DataBase Reference | 85118-00-9(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34-36 | | Safety Statements | 26-36/37/39-45-25-27 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 10-19-21 | | Hazard Note | Corrosive/Lachrymatory | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29039990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | 2,6-Difluorobenzyl bromide Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 2,6-Difluorobenzyl bromide has been used:
- as reagent in alkylation of the quinazoline-2-thioxo-4-one
- in the synthesis of 1,3,5-triazine-2,4,6-triones
- in the preparation of new classes of inhibitors of bovine viral diarrhea virus (as a surrogate virus for hepatitis C virus)
|
| | 2,6-Difluorobenzyl bromide Preparation Products And Raw materials |
| Raw materials | 2,6-Difluorobenzyl alcohol-->2,6-Difluorotoluene-->Benzoic acid, 3,5-dichloro-2,4,6-trifluoro-, methyl ester-->2,6-Difluorobenzaldehyde-->METHYL 2,6-DIFLUOROBENZOATE | | Preparation Products | 5-Bromo-1-(2,6-difluorobenzyl)-1H-pyrazole-->Thieno[2,3-d]pyrimidine-2,4(1H,3H)-dione, 1-[(2,6-difluorophenyl)methyl]-5-methyl-6-(4-nitrophenyl)-3-phenyl--->2-acetaMido-3-(2,6-difluorophenyl)propaNAic acid-->ethyl 2-((2,6-difluorobenzyl)(ethoxycarbonyl)amino)-4-methyl-5-(4-nitrophenyl)thiophene-3-carboxylate |
|