Di-2-pyridylglyoxal manufacturers
- Di-2-pyridylglyoxal
-
- $1.00 / 1KG
-
2025-12-12
- CAS:492-73-9
- Min. Order: 1KG
- Purity: 95%
- Supply Ability: 9000KG
- Di-2-pyridylglyoxal
-
- $15.00 / 1KG
-
2021-08-12
- CAS:492-73-9
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | Di-2-pyridylglyoxal Basic information |
| | Di-2-pyridylglyoxal Chemical Properties |
| Melting point | 154-156 °C(lit.) | | Boiling point | 400.0±20.0 °C(Predicted) | | density | 1.271±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | form | solid | | pka | 1.31±0.10(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C12H8N2O2/c15-11(9-5-1-3-7-13-9)12(16)10-6-2-4-8-14-10/h1-8H | | InChIKey | PIINXYKJQGMIOZ-UHFFFAOYSA-N | | SMILES | C(C1=NC=CC=C1)(=O)C(C1=NC=CC=C1)=O | | CAS DataBase Reference | 492-73-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Di-2-pyridylglyoxal Usage And Synthesis |
| | Di-2-pyridylglyoxal Preparation Products And Raw materials |
|