|
|
| | N-NONYL-BETA-D-GLUCOPYRANOSIDE Basic information |
| | N-NONYL-BETA-D-GLUCOPYRANOSIDE Chemical Properties |
| Melting point | 70°C(lit.) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | soluble in Methanol | | form | Powder | | color | White to Off-white | | Water Solubility | water: 250mg/mL | | BRN | 12168 | | InChI | InChI=1/C15H30O6/c1-2-3-4-5-6-7-8-9-20-15-14(19)13(18)12(17)11(10-16)21-15/h11-19H,2-10H2,1H3/t11-,12-,13+,14-,15-/s3 | | InChIKey | QFAPUKLCALRPLH-UXXRCYHCSA-N | | SMILES | [C@H]1(OCCCCCCCCC)[C@H](O)[C@H]([C@H](O)[C@@H](CO)O1)O |&1:0,11,13,14,16,r| |
| | N-NONYL-BETA-D-GLUCOPYRANOSIDE Usage And Synthesis |
| Uses | n-Nonyl-beta-D-glucopyranoside is a nonionic surfactant. | | Purification Methods | Purify nonyl--D-glucopyranoside by recrystallisation from Me2CO or hexane/Et2O and store it in well-stoppered containers as it is hygroscopic. [Pigman & Richtmyer J Am Chem Soc 64 369 1942.] It is a UV transparent non-ionic detergent for solubilising membrane proteins [Schwendener et al. Biochem Biophys Res Commun 100 1055 1981]. [Beilstein 17 III/IV 2937, 17/7 V 39.] |
| | N-NONYL-BETA-D-GLUCOPYRANOSIDE Preparation Products And Raw materials |
|