6-IODOIMIDAZO[1,2-A]PYRIDINE manufacturers
|
| | 6-IODOIMIDAZO[1,2-A]PYRIDINE Basic information |
| | 6-IODOIMIDAZO[1,2-A]PYRIDINE Chemical Properties |
| Melting point | 130-131°C | | density | 2.01±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | Solid | | pka | 5.27±0.50(Predicted) | | Appearance | Off-white to brown Solid | | InChI | InChI=1S/C7H5IN2/c8-6-1-2-7-9-3-4-10(7)5-6/h1-5H | | InChIKey | ZYXOOFUOEJPQKM-UHFFFAOYSA-N | | SMILES | C12=NC=CN1C=C(I)C=C2 |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2933998090 |
| | 6-IODOIMIDAZO[1,2-A]PYRIDINE Usage And Synthesis |
| | 6-IODOIMIDAZO[1,2-A]PYRIDINE Preparation Products And Raw materials |
|