|
|
| | 6-CHLORO-2,4-DIMETHOXYPYRIMIDINE Basic information |
| Product Name: | 6-CHLORO-2,4-DIMETHOXYPYRIMIDINE | | Synonyms: | AURORA KA-4916;2,4-DIMETHOXY-6-CHLOROPYRIMIDINE;6-CHLORO-2,4-DIMETHOXYPYRIMIDINE;4-CHLORO-2,6-DIMETHOXYPYRIMIDINE;6-chloro-2,4-dimethixypyrimidine;6-CHLORO-2,4-DIMETHOXYPYRIMIDINE, 98+%;2,6-Dimethoxy-4-chloropyrimidine;4-diMethoxy pyriMidine | | CAS: | 6320-15-6 | | MF: | C6H7ClN2O2 | | MW: | 174.59 | | EINECS: | 228-669-6 | | Product Categories: | Building Blocks;Halogenated Heterocycles;Heterocyclic Building Blocks;Pyrimidines;PyrimidinesHeterocyclic Building Blocks;Pyridines, Pyrimidines, Purines and Pteredines;Aromatics;Heterocycles | | Mol File: | 6320-15-6.mol |  |
| | 6-CHLORO-2,4-DIMETHOXYPYRIMIDINE Chemical Properties |
| Melting point | 74-76 °C(lit.) | | Boiling point | 280.6±43.0 °C(Predicted) | | density | 1.285±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in chloroform, ethyl acetate and methanol. | | form | Solid | | pka | -1.92±0.30(Predicted) | | color | White | | Sensitive | Hygroscopic | | BRN | 137581 | | InChI | InChI=1S/C6H7ClN2O2/c1-10-5-3-4(7)8-6(9-5)11-2/h3H,1-2H3 | | InChIKey | JHNRTJRDRWKAIW-UHFFFAOYSA-N | | SMILES | C1(OC)=NC(OC)=CC(Cl)=N1 | | CAS DataBase Reference | 6320-15-6(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29335995 | | Storage Class | 11 - Combustible Solids |
| | 6-CHLORO-2,4-DIMETHOXYPYRIMIDINE Usage And Synthesis |
| Description | 6-Chloro-2,4-dimethoxypyrimidine serves as a key intermediate in pharmaceuticals, pesticides and fine chemical engineering. It is commonly used in the synthesis of sulfonylurea herbicides , and also applied to the preparation of pyrimidine ring-containing pharmaceutically active molecules. In addition, it acts as a heterocyclic building block to participate in the construction of pyrimidine derivatives, which is suitable for the research, development and production of functional molecules in organic synthesis and materials chemistry. | | Chemical Properties | White powder or flakes | | Uses | It is used in the synthesis of silyl and stannyl pyrimidines. |
| | 6-CHLORO-2,4-DIMETHOXYPYRIMIDINE Preparation Products And Raw materials |
|