| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Products Intro: |
Product Name:3-(6-diphenylphosphinyl(naphth-2-yl))-1,10-phenanthroline
CAS:1480371-38-7
Purity:95%+ Package:1g;10g;100g;1KG;5KG
|
| Company Name: |
ShangHai Biochempartner Co.,Ltd
|
| Tel: |
177-54423994 17754423994 |
| Email: |
2853530910@QQ.com |
| Products Intro: |
Product Name:Phen-NaDPO
CAS:1480371-38-7
Purity:98% HPLC LCMS Package:100MG;1G
|
Phen-NaDPO manufacturers
- Phen-NaDPO
-
- $0.00 / 1g
-
2025-12-22
- CAS:1480371-38-7
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 100kgs
|
| | Phen-NaDPO Basic information |
| Product Name: | Phen-NaDPO | | Synonyms: | Phen-NaDPO;1,10-Phenanthroline, 3-[6-(diphenylphosphinyl)-2-naphthalenyl]-;[6-(1,10-Phenanthrolin-3-yl)-2-naphthyl]diphenylphosphine Oxide;3-[6-(diphenylphosphinyl)-2-naphthalenyl]-1,10-Phenanthroline;3-(6-diphenylphosphinyl(naphth-2-yl))-1,10-phenanthroline;(6-(1,10-Phenanthrolin-3-yl)naphthalen-2-yl)diphenylphosphine oxide | | CAS: | 1480371-38-7 | | MF: | C34H23N2OP | | MW: | 506.53 | | EINECS: | | | Product Categories: | | | Mol File: | 1480371-38-7.mol |  |
| | Phen-NaDPO Chemical Properties |
| Boiling point | 762.2±60.0 °C(Predicted) | | density | 1.33±0.1 g/cm3(Predicted) | | solubility | soluble (Soluble in polar and weakly polar solvents such as isopropanol, toluene and xylenes) | | pka | 4.55±0.10(Predicted) | | form | powder | | Water Solubility | soluble (Soluble in polar and weakly polar solvents such as isopropanol, toluene and xylenes) | | semiconductor properties | (mobility=0.0001-0.001cm2/V·s) (electron) | | InChI | 1S/C34H23N2OP/c37-38(30-9-3-1-4-10-30,31-11-5-2-6-12-31)32-18-17-25-20-26(14-15-27(25)22-32)29-21-28-16-13-24-8-7-19-35-33(24)34(28)36-23-29/h1-23H | | InChIKey | OAOXYBSWOZWDBB-UHFFFAOYSA-N | | SMILES | [P](=O)(c7ccccc7)(c6ccccc6)c1cc2c(cc(cc2)c3cnc4c5ncccc5ccc4c3)cc1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Phen-NaDPO Usage And Synthesis |
| Uses | Phen-NaDPO is a universal cathode modifier for organic optoelectronics. Phen-NaDPO can significantly lower the work function of the Ag metal as well as ITO and HOPG.
It lowers the energy loss between organic layer and the metal electrode, results in higher acheiveable efficiency for organic solar cells. It is also used as cathode interfacial material for inverted Perovskite solar cells, and electron transport materials for Perovskite solar cells and other organic electronic devices in general. |
| | Phen-NaDPO Preparation Products And Raw materials |
|