|
|
| | 3,5-DICHLOROSALICYLALDEHYDE Basic information |
| Product Name: | 3,5-DICHLOROSALICYLALDEHYDE | | Synonyms: | Benzaldehyde,3,5-dichloro-2-hydroxy-;Salicylaldehyde, 3,5-dichloro-;Salicylaldehyde,3,5-dichloro-;AKOS B029257;3,5-DICHLORO SALICYLAL;3,5-DICHLOROSALICYLALDEHYDE;3,5-DICHLORO-2-HYDROXYBENZALDEHYDE;LABOTEST-BB LT00089371 | | CAS: | 90-60-8 | | MF: | C7H4Cl2O2 | | MW: | 191.01 | | EINECS: | 202-005-5 | | Product Categories: | Aromatic Aldehydes & Derivatives (substituted);Benzaldehyde;Aldehydes;C7;Carbonyl Compounds | | Mol File: | 90-60-8.mol |  |
| | 3,5-DICHLOROSALICYLALDEHYDE Chemical Properties |
| Melting point | 95-97 °C (lit.) | | Boiling point | 273.68°C (rough estimate) | | density | 1.4410 (rough estimate) | | refractive index | 1.4590 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | ethanol: soluble5%, clear, faintly yellow to greenish-yellow | | pka | 6.27±0.23(Predicted) | | form | Crystalline Powder | | color | Pale yellow | | Water Solubility | Insoluble in water. Solubility in methanol is almost transparent. | | Sensitive | Air Sensitive | | BRN | 973391 | | InChI | InChI=1S/C7H4Cl2O2/c8-5-1-4(3-10)7(11)6(9)2-5/h1-3,11H | | InChIKey | FABVMBDCVAJXMB-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC(Cl)=CC(Cl)=C1O | | CAS DataBase Reference | 90-60-8(CAS DataBase Reference) | | EPA Substance Registry System | Benzaldehyde, 3,5-dichloro-2-hydroxy- (90-60-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 29121900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3,5-DICHLOROSALICYLALDEHYDE Usage And Synthesis |
| Chemical Properties | pale yellow crystalline powder | | Uses | 3,5-Dichlorosalicylaldehyde has been used in the preparation of Schiff base ligands and (RS)-3,5-dichloro-2-[[(1-phenylethyl)imino]methyl]phenol. | | Uses | 3,5-Dichlorosalicylaldehyde has been used in the preparation of:
- Schiff base ligands
- (RS)-3,5-dichloro-2-[[(1-phenylethyl)imino]methyl]phenol
| | Synthesis | The general procedure for the synthesis of 3,5-dichlorosalicylaldehyde from urotropine and 2,4-dichlorophenol was as follows: first, 2,4-dichlorophenol (10.0 g, 61.3 mmol) and hexamethylenetetetramine (17.2 g, 122.6 mmol) were dissolved in 80 mL of methanesulfonic acid, and the reaction mixture was heated and stirred for 1.5 hours at 100 °C. After the reaction was completed, the reaction mixture was diluted with ethyl acetate, and the organic layer was washed sequentially with water and saturated sodium bicarbonate solution, and then dried with anhydrous magnesium sulfate. The solvent was removed by evaporation under reduced pressure to give the crude product. The crude product was purified by column chromatography using ethyl acetate/hexane gradient elution to afford the target compound 3,5-dichloro-2-hydroxybenzaldehyde (INT-01) as a yellow oil (7.5 g, 64% yield). The structure of the product was confirmed by 1H NMR (400 MHz, CDCl3): δ11.39 (s, 1H), 7.64 (s, 1H), 7.52 (s, 1H). Liquid chromatography (LC) analytical conditions: C-18 column, 5 min to 95% acetonitrile/water gradient elution, flow rate 1.7 mL/min, detection wavelength 254 nm, column temperature 23 ℃, retention time (tr) = 3.95 min. | | References | [1] Patent: WO2015/109011, 2015, A1. Location in patent: Paragraph 0205; 0206
[2] Patent: WO2015/109014, 2015, A1. Location in patent: Paragraph 0204; 0205
[3] Patent: US2015/197500, 2015, A1. Location in patent: Paragraph 0263; 0264
[4] Chemical & Pharmaceutical Bulletin, 1983, vol. 31, # 5, p. 1751 - 1753
[5] Journal of the Chemical Society, 1941, p. 547,549 |
| | 3,5-DICHLOROSALICYLALDEHYDE Preparation Products And Raw materials |
|