| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Nextpeptide Inc |
| Tel: |
+86-0571-81612335 +8613336028439 |
| Email: |
sales@nextpeptide.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 4-methoxybenzenesulfonyl fluoride Basic information |
| Product Name: | 4-methoxybenzenesulfonyl fluoride | | Synonyms: | 4-methoxybenzenesulfonyl fluoride;4-Methoxybenzenesulfonyl fluoride 95%;Benzenesulfonyl fluoride, 4-methoxy-;4-methoxybenzene-1-sulfonyl fluoride | | CAS: | 368-91-2 | | MF: | C7H7FO3S | | MW: | 190.19 | | EINECS: | | | Product Categories: | | | Mol File: | 368-91-2.mol |  |
| | 4-methoxybenzenesulfonyl fluoride Chemical Properties |
| Melting point | 13 °C | | Boiling point | 175 °C(Press: 60 Torr) | | density | 1.339 g/L at 25 °C | | refractive index | n/D 1.154 | | form | liquid | | InChI | 1S/C7H7FO3S/c1-11-6-2-4-7(5-3-6)12(8,9)10/h2-5H,1H3 | | InChIKey | QHEMDSDRFAIOOU-UHFFFAOYSA-N | | SMILES | FS(C1=CC=C(OC)C=C1)(=O)=O |
| WGK Germany | WGK 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | 4-methoxybenzenesulfonyl fluoride Usage And Synthesis |
| Uses | Sulfonyl fluoride motif can be used as a connector for the assembly of -SO2- linked small molecules with proteins or nucleic acids. This new click chemistry approach through sulfates is a complimentary approach for the usage of amides and phosphate groups as linkers. | | reaction suitability | reaction type: click chemistry |
| | 4-methoxybenzenesulfonyl fluoride Preparation Products And Raw materials |
|