BMS-1001 manufacturers
- BMS-1001
-
- $56.00
-
2026-07-14
- CAS:2113650-03-4
- Purity: 98.89%
- Supply Ability: 10g
|
| | BMS-1001 Basic information |
| Product Name: | BMS-1001 | | Synonyms: | BMS-1001;D-Serine, N-[[2-[(3-cyanophenyl)methoxy]-4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylphenyl]methoxy]-5-methylphenyl]methyl]-;2113650-03-4 (free base);BMS 1001,BMS1001;BMS-1001, 10 mM in DMSO;(2-((3-Cyanobenzyl)oxy)-4-((3-(2,3-dihydrobenzo[b][1,4]dioxin-6-yl)-2-methylbenzyl)oxy)-5-methylbenzyl)-D-serine | | CAS: | 2113650-03-4 | | MF: | C35H34N2O7 | | MW: | 594.65 | | EINECS: | | | Product Categories: | | | Mol File: | 2113650-03-4.mol |  |
| | BMS-1001 Chemical Properties |
| Boiling point | 801.2±65.0 °C(Predicted) | | density | 1.34±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO: 50 mg/mL (84.08 mM);Ethanol: Insoluble | | pka | 2.08±0.10(Predicted) | | Water Solubility | Water: Insoluble | | InChIKey | UWNXGZKSIKQKAH-SSEXGKCCSA-N | | SMILES | C(O)(=O)[C@@H](CO)NCC1=CC(C)=C(OCC2=CC=CC(C3=CC=C4OCCOC4=C3)=C2C)C=C1OCC1=CC=CC(C#N)=C1 |
| | BMS-1001 Usage And Synthesis |
| Uses | BMS-1001 is a potent inhibitor of PD-1/PD-L1 interaction (IC50: 2.25 nM in a homogeneous time-resolved fluorescence binding assay). | | Biological Activity | BMS-1001 is a potent inhibitor of PD-1/PD-L1 interaction with EC50 of 253 nM. It attenuates the inhibitory effect of soluble PD-L1 on T cell receptor-mediated T lymphocyte activation. | | target | | Target | Value | PD-1/PD-L1 (Cell-free assay) | 253 nM(EC50) |
|
| | BMS-1001 Preparation Products And Raw materials |
|