|
|
| | N-Ethyl-N-cyanoethyl-m-toluidine Basic information |
| Product Name: | N-Ethyl-N-cyanoethyl-m-toluidine | | Synonyms: | 3-[ethyl(3-methylphenyl)amino]-Propanenitrile;N-(2-Cyanoethyl)-N-ethyl-m-toluidine;N-cyanoethyl-N-ethyl-m-Toluidine;n-ethylcyano-n-ethyl-m-toluidine;Propanenitrile,3-[ethyl(3-methylphenyl)amino]-;3-(N-ETHYL-M-TOLUIDINO)PROPIONONITRILE;3-(N-Ethyl-meta-toluidino)-propionitrile;3-(ETHYL-M-TOLYL-AMINO)-PROPIONITRILE | | CAS: | 148-69-6 | | MF: | C12H16N2 | | MW: | 188.27 | | EINECS: | 205-721-6 | | Product Categories: | Intermediates of Dyes and Pigments | | Mol File: | 148-69-6.mol |  |
| | N-Ethyl-N-cyanoethyl-m-toluidine Chemical Properties |
| Boiling point | 337.8±25.0 °C(Predicted) | | density | 1.008±0.06 g/cm3(Predicted) | | refractive index | 1.5470 to 1.5510 | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | clear liquid | | pka | 5.42±0.50(Predicted) | | color | Colorless to Light orange to Yellow | | InChI | InChI=1S/C12H16N2/c1-3-14(9-5-8-13)12-7-4-6-11(2)10-12/h4,6-7,10H,3,5,9H2,1-2H3 | | InChIKey | NPCCPMHHNIOSHL-UHFFFAOYSA-N | | SMILES | C(#N)CCN(CC)C1=CC=CC(C)=C1 | | CAS DataBase Reference | 148-69-6(CAS DataBase Reference) | | EPA Substance Registry System | Propanenitrile, 3-[ethyl(3-methylphenyl)amino]- (148-69-6) |
| RTECS | TZ4695000 | | TSCA | TSCA listed | | HS Code | 2926907090 |
| | N-Ethyl-N-cyanoethyl-m-toluidine Usage And Synthesis |
| Chemical Properties | Brown liquid. | | Uses | N-Ethyl-N-cyanoethyl-m-toluidine can be used as an intermediate for disperse red 65, 88, 153, 179 and other dyes. |
| | N-Ethyl-N-cyanoethyl-m-toluidine Preparation Products And Raw materials |
|