|
|
| | 1,3-DIMETHYL-1H-PYRAZOL-4-AMINE Basic information | | Application |
| | 1,3-DIMETHYL-1H-PYRAZOL-4-AMINE Chemical Properties |
| Boiling point | 231.5±20.0 °C(Predicted) | | density | 1.17±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | pka | 4.18±0.10(Predicted) | | Appearance | Brown to black Oil | | InChI | InChI=1S/C5H9N3/c1-4-5(6)3-8(2)7-4/h3H,6H2,1-2H3 | | InChIKey | AXLKRXWNAFFPDB-UHFFFAOYSA-N | | SMILES | N1(C)C=C(N)C(C)=N1 |
| Hazard Codes | Xi | | HazardClass | IRRITANT |
| | 1,3-DIMETHYL-1H-PYRAZOL-4-AMINE Usage And Synthesis |
| Application | 1,3-Dimethyl-4-aminopyrazole compounds have attracted widespread attention due to their extensive use in the synthesis of active drug molecules for the treatment of a variety of diseases. These include drugs for the treatment of malignant tumors, cardiovascular diseases, chemokine-related diseases (such as asthma, allergies, and rheumatoid arthritis), nervous system diseases, bacterial and viral infections, immune system-related diseases, and cancer. |
| | 1,3-DIMETHYL-1H-PYRAZOL-4-AMINE Preparation Products And Raw materials |
|