|
|
| | 7,7-Dichlorobicyclo[3.2.0]hept-2-en-6-one Basic information |
| Product Name: | 7,7-Dichlorobicyclo[3.2.0]hept-2-en-6-one | | Synonyms: | 7,7-DICHLOROBICYCLO[3.2.0]HEPT-2-EN-6-ONE;7,7-DICHLOROBICYCLO[3.2.0]HEPT-2-ENE-6-ONE;7,7-DICHLOROBICYCLO[3.2.0]HEPT-2-ENONE;Bicyclo[3.2.0]hept-2-en-6-one, 7,7-dichloro-;Dichlorobicycloheptenone;7,7-Dichlorobicyclo3.2.0ühept-2-en-6-one, 97%;7,7-DICHLOROBICYCLO(3.2.0)HEPT-2-EN-6-ONE,98%;7,7-Dichloro[3.2.0]hept-2-en-6-one | | CAS: | 5307-99-3 | | MF: | C7H6Cl2O | | MW: | 177.03 | | EINECS: | 226-165-0 | | Product Categories: | | | Mol File: | 5307-99-3.mol | ![7,7-Dichlorobicyclo[3.2.0]hept-2-en-6-one Structure](CAS/GIF/5307-99-3.gif) |
| | 7,7-Dichlorobicyclo[3.2.0]hept-2-en-6-one Chemical Properties |
| Boiling point | 58-64 °C (0.5 mmHg) | | density | 1.44±0.1 g/cm3(Predicted) | | refractive index | 1.5150 | | Fp | 127-128°C/25mm | | storage temp. | Refrigerator (+4°C) | | form | liquid | | color | Clear, dark orange | | BRN | 2045059 | | InChI | InChI=1S/C7H6Cl2O/c8-7(9)5-3-1-2-4(5)6(7)10/h1,3-5H,2H2 | | InChIKey | JBPBARAOHIDZPU-UHFFFAOYSA-N | | SMILES | C12C(C(=O)C1(Cl)Cl)CC=C2 | | CAS DataBase Reference | 5307-99-3(CAS DataBase Reference) |
| | 7,7-Dichlorobicyclo[3.2.0]hept-2-en-6-one Usage And Synthesis |
| Chemical Properties | clear brown liquid | | Synthesis | Under nitrogen protection, to a solution of dichloracetyl chloride (34 g, 0.23 mol) and cyclopentadiene(60 ml, 0.7 mol) in pentane (230 ml), heated to reflux in a three-necked flask with constant pressure funnel and condenser tube, was added dropwise via funnel triethylamine (24 g, 0.24 mol) in pentane (100 ml) with mechanical stirring during 4 hours, and a lot of white triethylamine hydrochloride was produced. After reflux for 2 hours, water (80 ml) was added to dissolve the triethylamine hydrochloride. The reaction mixture was extracted with pentane (2 × 60ml). The combined extracts were filtered and dried over anhydrous Na2SO4, and concentrated in vacuo to give brownish black oil. Fraction of reduced pressure distillation at 83~87 °C/400 Pa was collected to give 7,7-Dichlorobicyclo[3.2.0]hept-2-en-6-one (2, 33.5 g) as a colorless oil. |
| | 7,7-Dichlorobicyclo[3.2.0]hept-2-en-6-one Preparation Products And Raw materials |
|