2-TRIDECENOIC ACID manufacturers
- 2-TRIDECENOIC ACID
-
-
2025-06-27
- CAS:6969-16-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
- 2-TRIDECENOIC ACID
-
- $1.00
-
2019-07-06
- CAS:6969-16-0
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1kg,5kg,100kg
|
| | 2-TRIDECENOIC ACID Basic information |
| Product Name: | 2-TRIDECENOIC ACID | | Synonyms: | RARECHEM AL BK 0156;Tridecenoicacid;(Z)-TRIDEC-2-ENOIC ACID;2-TRIDECENOIC ACID;2-Tridecenoic Acid >;C13:1 12-Tridecenoic Acid | | CAS: | 6969-16-0 | | MF: | C13H24O2 | | MW: | 212.33 | | EINECS: | | | Product Categories: | | | Mol File: | 6969-16-0.mol |  |
| | 2-TRIDECENOIC ACID Chemical Properties |
| Melting point | 36°C | | Boiling point | 335.46°C (estimate) | | density | 0.8591 (rough estimate) | | refractive index | 1.4612 | | form | powder to lump to clear liquid | | color | White to Light yellow to Light orange | | InChI | InChI=1S/C13H24O2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h11-12H,2-10H2,1H3,(H,14,15) | | InChIKey | GQVYBECSNBLQJV-UHFFFAOYSA-N | | SMILES | C(O)(=O)C=CCCCCCCCCCC | | LogP | 5.243 (est) | | CAS DataBase Reference | 6969-16-0 |
| | 2-TRIDECENOIC ACID Usage And Synthesis |
| Uses | 2-Tridecenoic acid is an organic compound belonging to the class of fatty acids. It has a slightly rancid smell and is commonly found in a variety of foods, such as dairy products and meats. 2-Tridecenoic acid has various applications in the chemical and pharmaceutical industries, especially as an intermediate in the synthesis of various chemicals and pharmaceuticals. Additionally, it has potential utility in inhibiting bacterial infections and inflammation-related diseases. | | Definition | ChEBI: 3-n-decyl acrylic acid is a long-chain fatty acid. |
| | 2-TRIDECENOIC ACID Preparation Products And Raw materials |
|