| 
                    
                    
                    
                    
                    
                    
                    
                    
                        
                            
                                | Company Name: | AllyChem Co., Ltd. |  
                                | Tel: | 0411-62313318 13942603642 |  
                                | Email: | info@allychem.com |  
                                | Products Intro: | Product Name:5-(Tetramethyl-1,3,2-Dioxaborolan-2-yl)-2-(Trifluoromethyl)-1,3-Thiazole CAS:1415241-98-3
 Purity:99%  Package:1kg;5kg;10kg;571kg  Remarks:AC211059
 |  
                        
                            
                                | Company Name: | Combiphos (Shanghai) Biological Technology Co., Ltd. |  
                                | Tel: | 021-65232103 17602124823 |  
                                | Email: | combiphos@vip.qq.com |  
                                | Products Intro: | Product Name:5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)thiazole CAS:1415241-98-3
 Purity:95% HPLC  Package:100 mg
250 mg
1.0 g
5 g
 |  
                    
                    5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)-1,3-thiazole manufacturers | |  |  | 5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)-1,3-thiazole Basic information | 
 | Product Name: | 5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)-1,3-thiazole |  | Synonyms: | 5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)-1,3-thiazole;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)thiazole;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)-1,3-thiazole;Thiazole, 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)-;2-(Trifluoromethyl)thiazole-5-boronic Acid pinacol ester |  | CAS: | 1415241-98-3 |  | MF: | C10H13BF3NO2S |  | MW: | 279.09 |  | EINECS: | 816-130-3 |  | Product Categories: |  |  | Mol File: | 1415241-98-3.mol |  |  | 
|  |  | 5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)-1,3-thiazole Chemical Properties | 
 | Boiling point | 273.5±40.0 °C(Predicted) |  | density | 1.26±0.1 g/cm3(Predicted) |  | storage temp. | -20°C, sealed storage, away from moisture |  | pka | -0.35±0.10(Predicted) |  | Appearance | White to off-white Solid |  | InChI | InChI=1S/C10H13BF3NO2S/c1-8(2)9(3,4)17-11(16-8)6-5-15-7(18-6)10(12,13)14/h5H,1-4H3 |  | InChIKey | HVPDTTZRUUSNJR-UHFFFAOYSA-N |  | SMILES | S1C(B2OC(C)(C)C(C)(C)O2)=CN=C1C(F)(F)F | 
|  |  | 5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)-1,3-thiazole Usage And Synthesis | 
|  |  | 5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)-1,3-thiazole Preparation Products And Raw materials | 
                 |