|
|
| | 4-(Trifluoromethylthio)benzoyl chloride Basic information |
| | 4-(Trifluoromethylthio)benzoyl chloride Chemical Properties |
| Boiling point | 229-230 °C (lit.) | | density | 1.445 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.5220(lit.) | | Fp | 117 °F | | storage temp. | 2-8°C, stored under nitrogen | | solubility | soluble in Chloroform, Ethyl Acetate | | form | clear liquid | | Specific Gravity | 1.430 | | color | Colorless to Light yellow | | Sensitive | Moisture Sensitive | | BRN | 2723544 | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C8H4ClF3OS/c9-7(13)5-1-3-6(4-2-5)14-8(10,11)12/h1-4H | | InChIKey | BCMFTOCCLOAGBP-UHFFFAOYSA-N | | SMILES | C(Cl)(=O)C1=CC=C(SC(F)(F)F)C=C1 | | CAS DataBase Reference | 330-14-3(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 10-34 | | Safety Statements | 16-26-36/37/39-45 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29309090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1B |
| | 4-(Trifluoromethylthio)benzoyl chloride Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | 4-(Trifluoromethylthio)benzoyl Chloride is a reactant in the preparation of anthranilic acids as selective and dual PPAR/FXR ligands. |
| | 4-(Trifluoromethylthio)benzoyl chloride Preparation Products And Raw materials |
|