| Company Name: |
GLP Pharma Standards
|
| Tel: |
+91 9866074638 |
| Email: |
info@glppharmastandards.com |
| Products Intro: |
Product Name:Ketamine Impurity-B CAS:1823362-29-3 Purity:NLT 95% Package:25 MG 50 MG 100 MG 250 MG EXTRA
|
| Company Name: |
KARPSCHEM LABORATORIES
|
| Tel: |
+91-7249203006 |
| Email: |
info@karpschem.in |
| Products Intro: |
Product Name:Esketamine EP Impurity B
(2RS)-2-(2-chlorophenyl)-2-hydroxycyclohexanone CAS:1823362-29-3 Purity:96% Package:25 mg, 50 mg , 100mg or 500 mg
|
| Company Name: |
Shanghai Kewel Chemical Co., Ltd.
|
| Tel: |
021-64609169 18901607656 |
| Email: |
greensnown@163.com |
| Products Intro: |
Product Name:Esketamine hydrochloride EP Impurity B CAS:1823362-29-3 Purity:95+ HPLC; Package:10mg;25mg;50mg;100mg
|
Esketamine Hydrochloride EP Impurity B manufacturers
|
| | Esketamine Hydrochloride EP Impurity B Basic information |
| Product Name: | Esketamine Hydrochloride EP Impurity B | | Synonyms: | Esketamine Hydrochloride EP Impurity B;Ketamine EP Impurity B;Esketamine Hydrochloride Impurity 2 (Esketamine Hydrochloride EP Impurity B);2-(2-Chlorophenyl)-2-hydroxycyclohexanone;Ketamine hydrochloride EP Impurity B;Esketamine Hydrochloride Impurity B;Ketamine Hydrochloride Impurity B;Ketamine EP Impurity B (Esketamine EP Impurity B) | | CAS: | 1823362-29-3 | | MF: | C12H13ClO2 | | MW: | 224.68 | | EINECS: | | | Product Categories: | | | Mol File: | 1823362-29-3.mol |  |
| | Esketamine Hydrochloride EP Impurity B Chemical Properties |
| Boiling point | 383.3±42.0 °C(Predicted) | | density | 1.287±0.06 g/cm3(Predicted) | | solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; DMSO:PBS (pH 7.2) (1:7): 0.12 mg/ml; Ethanol: 5 mg/ml | | form | A crystalline solid | | pka | 11.84±0.20(Predicted) | | InChI | InChI=1S/C12H13ClO2/c13-10-6-2-1-5-9(10)12(15)8-4-3-7-11(12)14/h1-2,5-6,15H,3-4,7-8H2 | | InChIKey | TXHGZWYEGMFTJB-UHFFFAOYSA-N | | SMILES | C1(=O)CCCCC1(C1=CC=CC=C1Cl)O |
| | Esketamine Hydrochloride EP Impurity B Usage And Synthesis |
| Uses | 2-Hydroxy-2-(o-chlorophenyl)cyclohexanone is a compound for inhibiting neoproliferative changes in blood vessel walls. A byproduct in the synthesis of Esketamine. |
| | Esketamine Hydrochloride EP Impurity B Preparation Products And Raw materials |
|