|
|
| | N-Boc-beta-phenyl-D-phenylalaninol Basic information |
| Product Name: | N-Boc-beta-phenyl-D-phenylalaninol | | Synonyms: | tert-butyl [(2R)-3-hydroxy-1,1-diphenylpropan-2-yl]carbamate;N-[1-hydroxy-3-(3-phenylphenyl)propan-2-yl]carbamic acid tert-butyl ester;tert-butyl N-[(2R)-3-hydroxy-1,1-diphenylpropan-2-yl]carbamate;N-(TERT-BUTOXYCARBONYL)-BETA-PHENYL-D-PHENYLALANINOL;N-BOC-BETA-PHENYL-D-PHENYLALANINOL;N-(TERT-BUTOXYCARBONYL)-BETA-PHENYL-D-PH;n-(tert-butoxycarbonyl)-β-phenyl-d-phenylalaninol;Zinc02389290 | | CAS: | 155836-48-9 | | MF: | C20H25NO3 | | MW: | 327.42 | | EINECS: | 604-604-1 | | Product Categories: | Chiral Compound | | Mol File: | 155836-48-9.mol |  |
| | N-Boc-beta-phenyl-D-phenylalaninol Chemical Properties |
| Melting point | 114-116 °C(lit.) | | alpha | -21 º (c=1 in methanol) | | Boiling point | 501.2±50.0 °C(Predicted) | | density | 1.108±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 11.72±0.46(Predicted) | | form | solid | | color | White | | Optical Rotation | [α]22/D 21°, c = 1 in methanol | | Major Application | peptide synthesis | | InChI | 1S/C20H25NO3/c1-20(2,3)24-19(23)21-17(14-22)18(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13,17-18,22H,14H2,1-3H3,(H,21,23)/t17-/m0/s1 | | InChIKey | OGVCRJDQGBIHAG-KRWDZBQOSA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](CO)C(c1ccccc1)c2ccccc2 | | CAS DataBase Reference | 155836-48-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2924297099 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | N-Boc-beta-phenyl-D-phenylalaninol Usage And Synthesis |
| | N-Boc-beta-phenyl-D-phenylalaninol Preparation Products And Raw materials |
|