| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4,5-Dihydronaphtho[1,2-b]thiophene-2-carbaldehyde Basic information |
| | 4,5-Dihydronaphtho[1,2-b]thiophene-2-carbaldehyde Chemical Properties |
| Boiling point | 138-142 °C(Press: 0.1 Torr) | | density | 1.281±0.06 g/cm3(Predicted) | | form | solid | | InChI | 1S/C13H10OS/c14-8-11-7-10-6-5-9-3-1-2-4-12(9)13(10)15-11/h1-4,7-8H,5-6H2 | | InChIKey | GKAHZJIMBQGZAH-UHFFFAOYSA-N | | SMILES | O=CC1=CC(CCC2=CC=CC=C23)=C3S1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | 4,5-Dihydronaphtho[1,2-b]thiophene-2-carbaldehyde Usage And Synthesis |
| | 4,5-Dihydronaphtho[1,2-b]thiophene-2-carbaldehyde Preparation Products And Raw materials |
|