|
|
| | 4-(CHLOROMETHYL)-2-METHYL-1,3-THIAZOLE Basic information |
| Product Name: | 4-(CHLOROMETHYL)-2-METHYL-1,3-THIAZOLE | | Synonyms: | 4-(Chloromethyl)-2-methyl-1,3-thiazole 95%;4-(CHLOROMETHYL)-2-METHYLTHIAZOLE;4-(CHLOROMETHYL)-2-METHYL-1,3-THIAZOLE;THIAZOLE, 4-(CHLOROMETHYL)-2-METHYL-;4-Chloromethyl-2-methylthiazole hydrochloride, 98;4-(Chloromethyl)-2-methylbenzothiazoleHCl;2-Methyl-4-(chloromethyl)thiazole;4-(chloromethyl)-2-methyl-1,3-thiazole(SALTDATA: FREE) | | CAS: | 39238-07-8 | | MF: | C5H6ClNS | | MW: | 147.63 | | EINECS: | | | Product Categories: | | | Mol File: | 39238-07-8.mol |  |
| | 4-(CHLOROMETHYL)-2-METHYL-1,3-THIAZOLE Chemical Properties |
| Melting point | 160-165°C (dec.) | | Boiling point | 217℃ | | density | 1.271 | | refractive index | 1.5440 | | Fp | 85℃ | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | oil | | color | Clear, faint green/faint orange | | BRN | 108603 | | InChI | InChI=1S/C5H6ClNS/c1-4-7-5(2-6)3-8-4/h3H,2H2,1H3 | | InChIKey | AQBBZYVPKBIILN-UHFFFAOYSA-N | | SMILES | S1C=C(CCl)N=C1C | | CAS DataBase Reference | 39238-07-8(CAS DataBase Reference) |
| | 4-(CHLOROMETHYL)-2-METHYL-1,3-THIAZOLE Usage And Synthesis |
| | 4-(CHLOROMETHYL)-2-METHYL-1,3-THIAZOLE Preparation Products And Raw materials |
|