|
|
| | 3,3,3-Tris(4-chlorophenyl)propionic acid Basic information |
| Product Name: | 3,3,3-Tris(4-chlorophenyl)propionic acid | | Synonyms: | 3,5-diphenyl-4,5-dihydro-1H-pyridazin-6-one;RARECHEM AL BO 1263;3,3,3-TRIS(4-CHLOROPHENYL)PROPIONIC ACID;3,3,3-tris(p-chlorophenyl)propionic acid;3,3,3,-Trise-(4-Chlorophenyl)-PropionicAcid;3,3,3-Tris(4-chlorophenyl)propionis acid;3,3,3-Tris-(4-Chlorophenyl)-Pr;3,3,3-tri-(4-Chlorophenyl)propionicacid | | CAS: | 2168-06-1 | | MF: | C21H15Cl3O2 | | MW: | 405.7 | | EINECS: | 218-509-3 | | Product Categories: | C13 to C42+;Carbonyl Compounds;Carboxylic Acids | | Mol File: | 2168-06-1.mol |  |
| | 3,3,3-Tris(4-chlorophenyl)propionic acid Chemical Properties |
| Melting point | 190-193 °C (lit.) | | storage temp. | Sealed in dry,Room Temperature | | InChI | 1S/C21H15Cl3O2/c22-17-7-1-14(2-8-17)21(13-20(25)26,15-3-9-18(23)10-4-15)16-5-11-19(24)12-6-16/h1-12H,13H2,(H,25,26) | | InChIKey | LHIVWYJOCNGZRI-UHFFFAOYSA-N | | SMILES | OC(=O)CC(c1ccc(Cl)cc1)(c2ccc(Cl)cc2)c3ccc(Cl)cc3 | | CAS DataBase Reference | 2168-06-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3,3,3-Tris(4-chlorophenyl)propionic acid Usage And Synthesis |
| Chemical Properties | Crystallization. Melting point 185-186℃. | | Uses | 3,3,3-Tris(4-chlorophenyl)propionic acid was used as a potent inhibitor for Yersinia PTP(protein-tyrosine phosphatase) YopH. |
| | 3,3,3-Tris(4-chlorophenyl)propionic acid Preparation Products And Raw materials |
|