|
|
| | (R)-9b
(Ack1 inhibitor (R)-9b) Basic information |
| Product Name: | (R)-9b
(Ack1 inhibitor (R)-9b) | | Synonyms: | Ack1 inhibitor (R)-9b;(R)-9b
(Ack1 inhibitor (R)-9b);2,4-Pyrimidinediamine, 5-chloro-N2-[4-(4-methyl-1-piperazinyl)phenyl]-N4-[[(2R)-tetrahydro-2-furanyl]methyl]-;(R)-5-Chloro-N2-(4-(4-methylpiperazin-1-yl)phenyl)-N4-((tetrahydrofuran-2-yl)methyl)pyrimidine-2,4-diamine | | CAS: | 1655527-68-6 | | MF: | C20H27ClN6O | | MW: | 402.92 | | EINECS: | | | Product Categories: | | | Mol File: | 1655527-68-6.mol |  |
| | (R)-9b
(Ack1 inhibitor (R)-9b) Chemical Properties |
| Boiling point | 617.8±65.0 °C(Predicted) | | density | 1.289±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 2mg/mL, clear | | pka | 7.87±0.42(Predicted) | | form | powder | | color | white to beige | | InChIKey | XUIDATLQOQYHBD-UNTBIKODSA-N | | SMILES | C[N+](CC1)([H])CCN1C(C=C2)=CC=C2NC3=NC(NC[C@@H]4OCCC4)=C(Cl)C=N3.CS(=O)([O-])=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | (R)-9b
(Ack1 inhibitor (R)-9b) Usage And Synthesis |
| Uses | (R)-9b is a potent inhibitor of ACK1 tyrosine kinase (IC50=56 nM) with anticancer activity. (R)-9b exhibits selectivity for ACK1 but has inhibitory effects on JAK family kinases JAK2 and Tyk2. (R)-9b can be used in the study of hormone-regulated cancers such as prostate and breast cancer[1]. | | Biological Activity | (R)-9bMS is a potent and selective inhibitor of ACK1 (TNK2) tyrosine kinase th at exhibits potent anticancer activity. (R)-9bMS attenuates AR and AR-V7 expression in prostate cancer cells. (R)-9bMS potently inhibits triple negative breast cancer (TNBC) cells proliferation. | | IC 50 | JAK2; Tyk2 | | References | [1] Lawrence H R, et al. Development of novel ACK1/TNK2 inhibitors using a fragment-based approach[J]. Journal of medicinal chemistry, 2015, 58(6): 2746-2763. DOI:10.1021/jm501929n |
| | (R)-9b
(Ack1 inhibitor (R)-9b) Preparation Products And Raw materials |
|